|
|
| | 2,5-DIBROMO-3-FLUOROPYRIDINE Basic information |
| | 2,5-DIBROMO-3-FLUOROPYRIDINE Chemical Properties |
| Boiling point | 215.9±35.0 °C(Predicted) | | density | 2.137±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | form | Solid | | pka | -3.99±0.20(Predicted) | | color | White | | InChI | InChI=1S/C5H2Br2FN/c6-3-1-4(8)5(7)9-2-3/h1-2H | | InChIKey | QEENLQKOTDHQEW-UHFFFAOYSA-N | | SMILES | C1(Br)=NC=C(Br)C=C1F |
| RIDADR | UN2811 | | HazardClass | 6.1 | | HS Code | 2933399990 |
| | 2,5-DIBROMO-3-FLUOROPYRIDINE Usage And Synthesis |
| Uses | 2,5-Dibromo-3-fluoropyridine can be used as PRC2 inhibitors to treat cancer. |
| | 2,5-DIBROMO-3-FLUOROPYRIDINE Preparation Products And Raw materials |
|