| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 2-(6-Chloro-2,3-dihydro-3-oxobenzo[b][1,4]oxazin-4-yl)acetohydrazide Basic information |
| Product Name: | 2-(6-Chloro-2,3-dihydro-3-oxobenzo[b][1,4]oxazin-4-yl)acetohydrazide | | Synonyms: | BUTTPARK 25\07-03;JRH-07703, 2-(6-Chloro-2,3-dihydro-3-oxobenzo[b][1,4]oxazin-4-yl)acetohydrazide, 97%;4H-1,4-Benzoxazine-4-acetic acid, 6-chloro-2,3-dihydro-3-oxo-, hydrazide;2-(6-Chloro-2,3-dihydro-3-oxobenzo[b][1,4]oxazin-4-yl)acetohydrazide | | CAS: | 121565-10-4 | | MF: | C10H10ClN3O3 | | MW: | 255.66 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File | ![2-(6-Chloro-2,3-dihydro-3-oxobenzo[b][1,4]oxazin-4-yl)acetohydrazide Structure](StructureFile/ChemBookStructure4/GIF/CB9688865.gif) |
| | 2-(6-Chloro-2,3-dihydro-3-oxobenzo[b][1,4]oxazin-4-yl)acetohydrazide Chemical Properties |
| Melting point | 190 °C | | Boiling point | 638.5±55.0 °C(Predicted) | | density | 1.469±0.06 g/cm3(Predicted) | | pka | 12.29±0.37(Predicted) | | form | solid | | InChI | 1S/C10H10ClN3O3/c11-6-1-2-8-7(3-6)14(4-9(15)13-12)10(16)5-17-8/h1-3H,4-5,12H2,(H,13,15) | | InChIKey | ZZEDLYSPWZWLFT-UHFFFAOYSA-N | | SMILES | ClC1=CC(N(C(CO2)=O)C/C(O)=N/N)=C2C=C1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Skin Sens. 1 |
| | 2-(6-Chloro-2,3-dihydro-3-oxobenzo[b][1,4]oxazin-4-yl)acetohydrazide Usage And Synthesis |
| | 2-(6-Chloro-2,3-dihydro-3-oxobenzo[b][1,4]oxazin-4-yl)acetohydrazide Preparation Products And Raw materials |
|