|
|
| | (R)-METHYL BOPHOZ(TM) Basic information | | Reaction |
| Product Name: | (R)-METHYL BOPHOZ(TM) | | Synonyms: | (R)-METHYL BOPHOZ(TM);(R)-N-DIPHENYLPHOSPHINO-N-METHYL-[(S)-2-(DIPHENYLPHOSPHINO)FERROCENYL]ETHYLAMINE;(S)-N-DIPHENYLPHOSPHINO-N-METHYL-[(R)-2-(DIPHENYLPHOSPHINO)FERROCENYL]ETHYLAMINE;(S)-METHYL BOPHOZ(TM);(R)-N-DIPHENYLPHOSPHINO-N-METHYL-[(S)-2-(DIPHENYLPHOSPHINO)FERROCENYL]ETHYLAMINE, (R)-METHYL BOPHOZ-;(R)-N-Diphenylphosphino-N-methyl-[(S)-2-(diphenylphosphino)ferrocenyl]ethylamine, (R)-Methyl BoPhozTM;(R)-N-Diphenylphosphino-N-methyl-(S)-2-(diphenylphosphino)ferrocenylüethylamine, (R)-Methyl BoPhoz;(R)-N-Methyl-N-diphenylphosphino-1-[(S)-2-diphenylphosphino)ferrocenyl]ethylamine | | CAS: | 406680-94-2 | | MF: | C37H35FeNP210* | | MW: | 611.47 | | EINECS: | | | Product Categories: | Chiral Phosphine | | Mol File: | 406680-94-2.mol |  |
| | (R)-METHYL BOPHOZ(TM) Chemical Properties |
| Melting point | 108.7-113.6 °C | | storage temp. | 2-8°C, protect from light, stored under nitrogen | | form | solid | | color | yellow | | Optical Rotation | Consistent with structure | | InChIKey | ZIAZHUWEJYUGEO-FBHGDYMESA-N | | SMILES | [Fe].[CH]1[CH][CH][CH][CH]1.C[C@H]([C]2[CH][CH][CH][C]2P(c3ccccc3)c4ccccc4)N(C)P(c5ccccc5)c6ccccc6 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| Provider | Language |
|
ALFA
| English |
| | (R)-METHYL BOPHOZ(TM) Usage And Synthesis |
| Reaction |
- Ligand for Rhodium-catalyzed asymmetric hydrogenation of dehydro-α-amino acid derivatives
- Ligand for Rhodium-catalyzed asymmetric hydrogenation of itacontate derivatives
- Ligand for Iridium-catalyzed asymmetric hydrogenation in the synthesis of an αvβ3 integrin antagonist intermediate
- Ligand for Rhodium-catalyzed asymmetric hydrogenation of β-amino-vinylphosphonates to β-aminophosphonates
| | Uses | Efficient ligand for asymmetric hydrogenation |
| | (R)-METHYL BOPHOZ(TM) Preparation Products And Raw materials |
|