|
|
| | N-Tosyl-L-alanine 3-indoxyl ester Basic information |
| | N-Tosyl-L-alanine 3-indoxyl ester Chemical Properties |
| Melting point | 38-39°C | | Boiling point | 577.9±60.0 °C(Predicted) | | density | 1.339±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 9.19±0.50(Predicted) | | color | Purple to Blue/Green to Grey/Green | | InChI | InChI=1S/C18H18N2O4S/c1-12-7-9-14(10-8-12)25(22,23)20-13(2)18(21)24-17-11-19-16-6-4-3-5-15(16)17/h3-11,13,19-20H,1-2H3/t13-/m0/s1 | | InChIKey | CBIVSVOVPJAVRE-ZDUSSCGKSA-N | | SMILES | C(OC1C2=C(NC=1)C=CC=C2)(=O)[C@H](C)NS(C1=CC=C(C)C=C1)(=O)=O |
| | N-Tosyl-L-alanine 3-indoxyl ester Usage And Synthesis |
| Chemical Properties | Purple Solid | | Uses | N-Tosyl-L-alanyloxyindole (cas# 75062-54-3) is a compound useful in organic synthesis. |
| | N-Tosyl-L-alanine 3-indoxyl ester Preparation Products And Raw materials |
|