2'-Deoxyadenosine 5'-phosphate manufacturers
|
| | 2'-Deoxyadenosine 5'-phosphate Basic information |
| | 2'-Deoxyadenosine 5'-phosphate Chemical Properties |
| Melting point | 148 °C | | Boiling point | 753.5±70.0 °C(Predicted) | | density | 2.17 | | storage temp. | -20°C | | solubility | DMSO (Slightly) | | pka | 1.86±0.10(Predicted) | | form | Crystalline Powder | | color | White | | biological source | synthetic (organic) | | Water Solubility | Soluble in 1N ammonium hhydroxide (50 mg/ml) and water. | | Stability: | Hygroscopic | | InChI | InChI=1S/C10H14N5O6P/c11-9-8-10(13-3-12-9)15(4-14-8)7-1-5(16)6(21-7)2-20-22(17,18)19/h3-7,16H,1-2H2,(H2,11,12,13)(H2,17,18,19)/t5-,6+,7+/m0/s1 | | InChIKey | KHWCHTKSEGGWEX-RRKCRQDMSA-N | | SMILES | P(OC[C@H]1O[C@@H](N2C3C(=C(N=CN=3)N)N=C2)C[C@@H]1O)(O)(O)=O | | CAS DataBase Reference | 653-63-4(CAS DataBase Reference) |
| | 2'-Deoxyadenosine 5'-phosphate Usage And Synthesis |
| Description | 2’-Deoxyadenosine-5''-monophosphate is a derivative of the nucleic acid, AMP, in which the hydroxyl group on the 2'' carbon of the pentose has been reduced to a hydrogen atom. It has been used in the synthesis of novel photoaffinity labels for incorporation into DNA and to study adenosine-based interactions during DNA synthesis and DNA damage. | | Chemical Properties | Crystalline | | Uses | 2’-Deoxyadenosine 5’Monophosphate is the first nucleotide of the phi 29 DNA. | | Definition | ChEBI: 2'-deoxyadenosine 5'-monophosphate is a purine 2'-deoxyribonucleoside 5'-monophosphate having adenine as the nucleobase. It has a role as a fundamental metabolite. It is a purine 2'-deoxyribonucleoside 5'-monophosphate and a 2'-deoxyadenosine 5'-phosphate. It is a conjugate acid of a 2'-deoxyadenosine 5'-monophosphate(2-). | | References | [1] M ZOFALL B B. Two novel dATP analogs for DNA photoaffinity labeling.[J]. Nucleic Acids Research, 2000, 28 21: 4382-4390. DOI: 10.1093/nar/28.21.4382
[2] De Souza, F.I., Zumiotti, A.V., and Da Silva, C.F. Neuregulins 1-α and 1-β on the regeneration the peripheral nerves[J]. Acta Ortop Bras.
[3] V DUARTE C J B J G Muller. Insertion of dGMP and dAMP during in vitro DNA synthesis opposite an oxidized form of 7,8-dihydro-8-oxoguanine.[J]. Nucleic Acids Research, 1999, 27 2: 496-502. DOI: 10.1093/nar/27.2.496 |
| | 2'-Deoxyadenosine 5'-phosphate Preparation Products And Raw materials |
|