|
| 4-ETHOXYBENZONITRILE Basic information |
| 4-ETHOXYBENZONITRILE Chemical Properties |
Melting point | 62-64 °C(lit.) | Boiling point | 258 °C(lit.) | density | 1.0921 (rough estimate) | refractive index | 1.5309 (estimate) | Fp | 258°C | storage temp. | Store at room temperature | form | powder to crystal | color | White to Light yellow | BRN | 2613602 | InChI | InChI=1S/C9H9NO/c1-2-11-9-5-3-8(7-10)4-6-9/h3-6H,2H2,1H3 | InChIKey | PJRLUGQMEZZDIY-UHFFFAOYSA-N | SMILES | C(#N)C1=CC=C(OCC)C=C1 | CAS DataBase Reference | 25117-74-2(CAS DataBase Reference) |
Hazard Codes | Xn | Risk Statements | 20/21/22-36/37/38 | Safety Statements | 26-37/39 | RIDADR | 3276 | WGK Germany | 3 | HazardClass | 6.1 | PackingGroup | III | HS Code | 2926907090 |
| 4-ETHOXYBENZONITRILE Usage And Synthesis |
| 4-ETHOXYBENZONITRILE Preparation Products And Raw materials |
|