|
|
| | 4-ETHOXYBENZONITRILE Basic information |
| | 4-ETHOXYBENZONITRILE Chemical Properties |
| Melting point | 62-64 °C(lit.) | | Boiling point | 258 °C(lit.) | | density | 1.0921 (rough estimate) | | refractive index | 1.5309 (estimate) | | Fp | 258°C | | storage temp. | Store at room temperature | | form | powder to crystal | | color | White to Light yellow | | BRN | 2613602 | | InChI | InChI=1S/C9H9NO/c1-2-11-9-5-3-8(7-10)4-6-9/h3-6H,2H2,1H3 | | InChIKey | PJRLUGQMEZZDIY-UHFFFAOYSA-N | | SMILES | C(#N)C1=CC=C(OCC)C=C1 | | CAS DataBase Reference | 25117-74-2(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-37/39 | | RIDADR | 3276 | | WGK Germany | 3 | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 2926907090 |
| | 4-ETHOXYBENZONITRILE Usage And Synthesis |
| | 4-ETHOXYBENZONITRILE Preparation Products And Raw materials |
|