|
|
| | 4-Methyl-3-nitrophenylboronic acid Basic information |
| | 4-Methyl-3-nitrophenylboronic acid Chemical Properties |
| Melting point | 265-270 °C (lit.) | | Boiling point | 356.7±52.0 °C(Predicted) | | density | 1.33±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | soluble in Methanol,Acetone | | form | powder to crystal | | pka | 7.19±0.10(Predicted) | | color | White to Light yellow to Light orange | | BRN | 3279018 | | InChI | 1S/C7H8BNO4/c1-5-2-3-6(8(10)11)4-7(5)9(12)13/h2-4,10-11H,1H3 | | InChIKey | OASVXBRTNVFKFS-UHFFFAOYSA-N | | SMILES | Cc1ccc(cc1[N+]([O-])=O)B(O)O | | CAS DataBase Reference | 80500-27-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-37 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29319090 | | Storage Class | 13 - Non Combustible Solids |
| | 4-Methyl-3-nitrophenylboronic acid Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder | | Uses | Reactant for:• ;Preparation of inhibitors of lactate dehydrogenase against cancer cell proliferation1• ;Suzuki-Miyaura coupling reactions2,3• ;Preparation of imidazothiazoles as iodide efflux inhibitors in thyrocytes4 | | Uses | Reactant for:
- Preparation of inhibitors of lactate dehydrogenase against cancer cell proliferation
- Suzuki-Miyaura coupling reactions
- Preparation of imidazothiazoles as iodide efflux inhibitors in thyrocytes
|
| | 4-Methyl-3-nitrophenylboronic acid Preparation Products And Raw materials |
|