- 2,4-Dibromomesitylene
-
- $5.00 / 1KG
-
2025-09-25
- CAS:6942-99-0
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
- 2,4-DIBROMOMESITYLENE
-
- $6.60 / 1KG
-
2019-12-26
- CAS: 6942-99-0
- Min. Order: 1KG
- Purity: 97%-99%
- Supply Ability: 1kg-1000kg
|
| | 2,4-DIBROMOMESITYLENE Basic information |
| Product Name: | 2,4-DIBROMOMESITYLENE | | Synonyms: | 2,4-Dibromo-1,3,5-trimethylbenzene;Mesitylene, 2,4-dibromo-;1,3-DIBROM-2,4,6-TRIMETHYLBENZOL;1,3,5-Trimethyl-2,4-dibromobenzene;1,3-Dibromo-2,4,6-trimethylbenzene;2,6-Dibromomesitylene;2,4-Dibromomesitylene,98%;2,4-DIBROMOMESITYLENE | | CAS: | 6942-99-0 | | MF: | C9H10Br2 | | MW: | 277.98 | | EINECS: | 230-100-1 | | Product Categories: | Aryl;C9 to C12;Halogenated Hydrocarbons | | Mol File: | 6942-99-0.mol |  |
| | 2,4-DIBROMOMESITYLENE Chemical Properties |
| Melting point | 61-63 °C(lit.) | | Boiling point | 278-279 °C(lit.) | | density | 1.6823 (rough estimate) | | refractive index | 1.6162 (estimate) | | Fp | 278-279°C | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | color | White to Almost white | | BRN | 2208246 | | InChI | InChI=1S/C9H10Br2/c1-5-4-6(2)9(11)7(3)8(5)10/h4H,1-3H3 | | InChIKey | CIHJFEWFZJQTFE-UHFFFAOYSA-N | | SMILES | C1(C)=CC(C)=C(Br)C(C)=C1Br | | CAS DataBase Reference | 6942-99-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HS Code | 29049095 |
| | 2,4-DIBROMOMESITYLENE Usage And Synthesis |
| Chemical Properties | white powder |
| | 2,4-DIBROMOMESITYLENE Preparation Products And Raw materials |
|