- (R)-MONOPHOS
-
- $0.00 / 1KG
-
2025-04-04
- CAS:185449-80-3
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1ton
- (R)-MONOPHOS
-
- $1.00 / 1KG
-
2019-08-06
- CAS:185449-80-3
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 10KG
|
| | (R)-MONOPHOS Basic information |
| Product Name: | (R)-MONOPHOS | | Synonyms: | 3,4-a']dinaphthalen-4-yl)dimethylamine,min.97%(S)-MONOPHOS;(S)-(+)-[4-N,N-DIMETHYLAMINO]DINAPHTHO[2,1-D:1'',2''-F][1,3,2]DIOXAPHOSPHEPIN (S)-MONOPHOS;(S)-(+)-(3,5-Dioxa-4-phospha-cyclohepta[2,1-a:3,4-a']dinaphthalen-4-yl)dimethylamine, min. 97% (S)-MONOPHOS;(S)-(+)-[4-N,N-Dimethylamino]dinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepin;(S)-(+)-[4-N,N-DIMETHYLAMINO]DINAPHTHO[2,1-D:1',2'-F][1,3,2]DIOXAPHOSPHEPINE;(S)-(+)-(3,5-DIOXA-4-PHOSPHA-CYCLOHEPTA[2,1-A:3,4-A']DI-NAPHTHALEN-4-YL)DIMETHYLAMINE;(R)-MONOPHOS;(S)-MONOPHOS | | CAS: | 185449-80-3 | | MF: | C22H18NO2P | | MW: | 359.36 | | EINECS: | | | Product Categories: | Chiral Phosphine;CPN | | Mol File: | 185449-80-3.mol |  |
| | (R)-MONOPHOS Chemical Properties |
| Melting point | 190 °C (dec.) | | alpha | +587° (c 0.06, CHCl3) | | Boiling point | 548.7±33.0 °C(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | crystal | | pka | 1.22±0.20(Predicted) | | color | white | | Optical Rotation | Consistent with structure | | Sensitive | moisture sensitive | | InChI | InChI=1S/C22H18NO2P/c1-23(2)26-24-19-13-11-15-7-3-5-9-17(15)21(19)22-18-10-6-4-8-16(18)12-14-20(22)25-26/h3-14H,1-2H3 | | InChIKey | QCHAVHXSBZARBO-UHFFFAOYSA-N | | SMILES | O1C2=CC=C3C(=C2C2=C4C(C=CC=C4)=CC=C2OP1N(C)C)C=CC=C3 |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 2929.90.5090 | | Storage Class | 11 - Combustible Solids |
| | (R)-MONOPHOS Usage And Synthesis |
| | (R)-MONOPHOS Preparation Products And Raw materials |
|