|
|
| | Neopentyl glycol diacrylate Basic information |
| Product Name: | Neopentyl glycol diacrylate | | Synonyms: | 2,2-Dimethylpropane-1,3-diyl diacrylate;2,2-dimethylpropane-1,3-dioldiacrylate;2,2-Dimethylpropanediacrylate;2,2-dimethyltrimethyleneacrylate;2-Propenoicacid,2,2-dimethyl-1,3-propanediylester;2-Propenoic acid, 1,1'-(2,2-dimethyl-1,3-propanediyl) ester;NEOPENTYL GLYCOL DIACRYLATE;1,3-BIS(ACRYLOYLOXY)-2,2-DIMETHYLPROPANE | | CAS: | 2223-82-7 | | MF: | C11H16O4 | | MW: | 212.24 | | EINECS: | 218-741-5 | | Product Categories: | Acrylic Monomers;Building Blocks;C10 to C11;Carbonyl Compounds;Chemical Synthesis;Materials Science;Monomers;Organic Building Blocks;Polyfunctional Acrylics;Polymer Science;Functional Monomer;Intermediates of Dyes and Pigments;Acrylic Monomers;C10 to C11Monomers;Carbonyl Compounds;Esters;Polyfunctional Acrylics;Diacrylates & Dimethacrylates;Functional Materials;Reagent for High-Performance Polymer Research | | Mol File: | 2223-82-7.mol |  |
| | Neopentyl glycol diacrylate Chemical Properties |
| Melting point | 6°C(lit.) | | Boiling point | 96°C/0.8mmHg(lit.) | | density | 1.031 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.453(lit.) | | Fp | >230 °F | | storage temp. | Store at room temperature | | Water Solubility | Practically insoluble in water | | solubility | Soluble in ether, alcohol | | form | clear liquid | | color | Colorless to Almost colorless | | InChI | InChI=1S/C11H16O4/c1-5-9(12)14-7-11(3,4)8-15-10(13)6-2/h5-6H,1-2,7-8H2,3-4H3 | | InChIKey | MXFQRSUWYYSPOC-UHFFFAOYSA-N | | SMILES | C(OC(=O)C=C)C(C)(C)COC(=O)C=C | | CAS DataBase Reference | 2223-82-7(CAS DataBase Reference) | | EPA Substance Registry System | Neopentyl glycol diacrylate (2223-82-7) |
| Hazard Codes | T | | Risk Statements | 24-36/38-43 | | Safety Statements | 28-39-45 | | RIDADR | UN 2810 6.1/PG 2 | | WGK Germany | 1 | | RTECS | AS8925000 | | TSCA | TSCA listed | | HazardClass | 6.1(b) | | PackingGroup | III | | HS Code | 29159000 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Dermal Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 | | Hazardous Substances Data | 2223-82-7(Hazardous Substances Data) | | Toxicity | rabbit,LD50,skin,180uL/kg (0.18mL/kg),LUNGS, THORAX, OR RESPIRATION: ACUTE PULMONARY EDEMABLOOD: HEMORRHAGESKIN AND APPENDAGES (SKIN): "DERMATITIS, OTHER: AFTER SYSTEMIC EXPOSURE",National Technical Information Service. Vol. OTS0537547, |
| | Neopentyl glycol diacrylate Usage And Synthesis |
| Uses | Neopentyl glycol diacrylate has the characteristics of strong dilution, good abrasion resistance and scribing resistance, and can be used as active diluent for radiation curing coatings, inks, adhesives and photopolymeric resin printing plates. |
| | Neopentyl glycol diacrylate Preparation Products And Raw materials |
|