|
|
| | 2',6'-Dihydroxyacetophenone Basic information |
| Product Name: | 2',6'-Dihydroxyacetophenone | | Synonyms: | Acetophenone, 2',6'-dihydroxy-;Acetyl-2,6-dihydroxybenzene;Ethanone, 1-(2,6-dihydroxyphenyl)-;gamma-Resacetophenone;2-Acetylbenzene-1,3-diol;NSC 615;DIHYDROXYACETOPHENONE(2,6-);Acetophenone, 2,6-dihydroxy- (3CI) | | CAS: | 699-83-2 | | MF: | C8H8O3 | | MW: | 152.15 | | EINECS: | 211-833-6 | | Product Categories: | Building Blocks;C7 to C8;Carbonyl Compounds;Chemical Synthesis;Ketones;Organic Building Blocks;FINE Chemical & INTERMEDIATES;Acetophenone series;Aromatics;Miscellaneous Reagents;Cromoglyn Sodium | | Mol File: | 699-83-2.mol |  |
| | 2',6'-Dihydroxyacetophenone Chemical Properties |
| Melting point | 156-158 °C(lit.) | | Boiling point | 234.6°C (rough estimate) | | density | 1.2143 (rough estimate) | | refractive index | 1.4447 (estimate) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | dioxane: 50 mg/mL, clear | | pka | 9.65±0.10(Predicted) | | form | Powder | | color | Yellow-beige | | Water Solubility | sparingly soluble | | BRN | 1366061 | | InChI | InChI=1S/C8H8O3/c1-5(9)8-6(10)3-2-4-7(8)11/h2-4,10-11H,1H3 | | InChIKey | YPTJKHVBDCRKNF-UHFFFAOYSA-N | | SMILES | C(=O)(C1=C(O)C=CC=C1O)C | | LogP | 1.922 (est) | | CAS DataBase Reference | 699-83-2(CAS DataBase Reference) | | NIST Chemistry Reference | 2',6'-Dihydroxyacetophenone(699-83-2) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-24/25 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29145000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2',6'-Dihydroxyacetophenone Usage And Synthesis |
| Chemical Properties | yellowish-beige powder | | Uses | 2'',6''-Dihydroxyacetophenone (cas# 699-83-2) is a compound useful in organic synthesis. | | Uses | Used with diammonium hydrogen citrate for MALDI-MS of PMP-labeled acidic and neutral glycans. | | Definition | ChEBI: 2',6'-Dihydroxyacetophenone is an aromatic ketone. | | Preparation | Preparation by hydrolysis of 8-acetyl-4-methyl-umbelliferone (8-acetyl-7-hydroxy-4-methylcoumarin) with aqueous sodium hydroxide solution at reflux (56–73%). |
| | 2',6'-Dihydroxyacetophenone Preparation Products And Raw materials |
|