- Diphenylacetyl chloride
-
- $0.00 / 1Kg
-
2020-02-26
- CAS: 1871-76-7
- Min. Order: 1KG
- Purity: 99.0%+
- Supply Ability: 100 tons
|
| | Diphenylacetyl chloride Basic information |
| | Diphenylacetyl chloride Chemical Properties |
| Melting point | 49-53 °C (lit.) | | Boiling point | 175-176 °C/17 mmHg (lit.) | | density | 1.1223 (rough estimate) | | refractive index | 1.5260 (estimate) | | Fp | >230 °F | | storage temp. | Store below +30°C. | | solubility | Chloroform (Slightly), DMSO (Slightly) | | form | Crystalline Powder | | color | Slightly yellow | | Sensitive | Moisture Sensitive | | Merck | 14,3316 | | BRN | 1211588 | | InChI | InChI=1S/C14H11ClO/c15-14(16)13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13H | | InChIKey | MSYLETHDEIJMAF-UHFFFAOYSA-N | | SMILES | C(C(Cl)=O)(C1C=CC=CC=1)C1=CC=CC=C1 | | CAS DataBase Reference | 1871-76-7(CAS DataBase Reference) | | NIST Chemistry Reference | Diphenylacetyl chloride(1871-76-7) |
| Hazard Codes | C | | Risk Statements | 34-36/37 | | Safety Statements | 26-27-28-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 2 | | RTECS | AO6750000 | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29163900 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1
Skin Corr. 1B |
| | Diphenylacetyl chloride Usage And Synthesis |
| Chemical Properties | SLIGHTLY YELLOWISH CRYSTALLINE POWDER | | Uses | Diphenylacetyl Chloride is a reagent used in the synthesis of β-lactam estrogen receptor antagonists promoting antiproliferative and anti-tubulin polymerizatiion activity. | | Uses | Diphenylacetyl chloride was used as a reagent in regioselective acylation of cyclomalto-oligosaccharides. It was also used in the preparation of N-substituted amides having local anesthetic properties. | | Preparation |
Diphenylacetyl Chloride is prepared by the action of Thionyl Chloride on diphenylacetic acid.
| | storage | Diphenylacetyl Chloride is corrosive; a lachrymator. Use in a fume hood. |
| | Diphenylacetyl chloride Preparation Products And Raw materials |
|