- harmaline
-
- $0.00 / 1kg
-
2026-04-23
- CAS:304-21-2
- Min. Order: 1kg
- Purity: 0.99
- Supply Ability: 1000kg
- HARMALINE
-
- $10.00 / 1ASSAYS
-
2026-04-22
- CAS:304-21-2
- Min. Order: 1ASSAYS
- Purity: 99%
- Supply Ability: 1 ton
|
| | HARMALINE Basic information |
| Product Name: | HARMALINE | | Synonyms: | 1-METHYL-7-METHOXY-3,4-DIHYDRO-BETA-CARBOLINE;TIMTEC-BB SBB003407;1-Methyl-7-methoxy-3,4-dihydroxy-beta-carboline;1-methyl-7-methoxy-3,4-dihydro-β-carboline;HARMALINE(EXTRACTFORMPEGANUMHARMALAROOTS);3,4-Dihydro-7-methoxy-1-methyl-beta-carboline
3,4-Dihydro-7-methoxy-1-methyl-9H-pyrido[3,4-b]indole
Dihydroharmine;NSC 407285;PYRIDE(3,4-B)INDOLE,4,9-DIHYDRO-7-METHOXY-1-METHYL- | | CAS: | 304-21-2 | | MF: | C13H14N2O | | MW: | 214.26 | | EINECS: | 206-152-6 | | Product Categories: | Inhibitors;Indoles and derivatives;Heterocyclic Compounds | | Mol File: | 304-21-2.mol |  |
| | HARMALINE Chemical Properties |
| Melting point | 232-234 °C(lit.) | | alpha | ±0° | | Boiling point | 354.4°C (rough estimate) | | density | 1.0850 (rough estimate) | | refractive index | 1.6450 (estimate) | | storage temp. | -10 to -25°C | | Water Solubility | Slightly soluble in water | | solubility | DMF: 1.4 mg/ml; DMF:PBS(pH 7.2)(1:1): 0.5 mg/ml; DMSO: 0.25 mg/ml; Ethanol: 0.5 mg/ml | | pka | 4.2(at 25℃) | | form | powder | | color | Light orange to Yellow to Green | | Merck | 14,4613 | | BRN | 207310 | | InChI | 1S/C13H14N2O/c1-8-13-11(5-6-14-8)10-4-3-9(16-2)7-12(10)15-13/h3-4,7,15H,5-6H2,1-2H3 | | InChIKey | RERZNCLIYCABFS-UHFFFAOYSA-N | | SMILES | COc1ccc2c3CCN=C(C)c3[nH]c2c1 | | LogP | 2.251 (est) | | CAS DataBase Reference | 304-21-2(CAS DataBase Reference) | | NIST Chemistry Reference | Harmaline(304-21-2) | | EPA Substance Registry System | 3H-Pyrido[3,4-b]indole, 4,9-dihydro-7-methoxy-1-methyl- (304-21-2) |
| Hazard Codes | Xn | | Risk Statements | 25-20/21/22 | | Safety Statements | 22-24/25-36 | | RIDADR | 1544 | | WGK Germany | 3 | | RTECS | UU9800000 | | HS Code | 2939.80.0000 | | HazardClass | 6.1(b) | | PackingGroup | III | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Inhalation
Acute Tox. 3 Oral
Flam. Liq. 2
STOT SE 1 | | Hazardous Substances Data | 304-21-2(Hazardous Substances Data) |
| | HARMALINE Usage And Synthesis |
| Uses | CNS stimulant, antiparkinsonian agent | | Uses | CNS stimulant; may act through NMDA receptors. Reversible inhibitor of MAO-A | | Definition | ChEBI: A harmala alkaloid in which the harman skeleton is methoxy-substituted at C-7 and has been reduced across the 3,4 bond. | | Synthesis Reference(s) | Canadian Journal of Chemistry, 37, p. 1851, 1959 DOI: 10.1139/v59-272 | | Biological Activity | CNS stimulant; may act through NMDA receptors | | Purification Methods | Recrystallise harmaline from MeOH and sublime it at high vacuum. It has UV in MeOH a |
| | HARMALINE Preparation Products And Raw materials |
|