|
|
| | (R)-N-Boc-1-Naphthylalanine Basic information |
| | (R)-N-Boc-1-Naphthylalanine Chemical Properties |
| Melting point | 145-148 °C(lit.) | | alpha | 53 º (c=2.5 in MeOH) | | Boiling point | 454.92°C (rough estimate) | | density | 1.2164 (rough estimate) | | refractive index | 1.5740 (estimate) | | storage temp. | Sealed in dry,2-8°C | | solubility | DMF: 25 mg/ml DMSO: 10 mg/ml Ethanol: 25 mg/ml | | pka | 3.88±0.30(Predicted) | | form | Solid | | color | White to off-white | | Optical Rotation | [α]22/D +53°, c = 2.5 in methanol | | BRN | 6180114 | | Major Application | peptide synthesis | | InChI | 1S/C18H21NO4/c1-18(2,3)23-17(22)19-15(16(20)21)11-13-9-6-8-12-7-4-5-10-14(12)13/h4-10,15H,11H2,1-3H3,(H,19,22)(H,20,21)/t15-/m1/s1 | | InChIKey | KHHIGWRTNILXLL-OAHLLOKOSA-N | | SMILES | CC(C)(C)OC(=O)N[C@H](Cc1cccc2ccccc12)C(O)=O | | CAS DataBase Reference | 76932-48-4(CAS DataBase Reference) |
| Hazard Codes | Xi | | Safety Statements | 24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29242990 | | Storage Class | 13 - Non Combustible Solids |
| | (R)-N-Boc-1-Naphthylalanine Usage And Synthesis |
| Chemical Properties | off-white to yellowish crystalline powder | | Uses | Boc-D-1-Nal-OH is an antiviral. | | reaction suitability | reaction type: Boc solid-phase peptide synthesis | | References | [1] OLGA V. GOZHINA Tore L John Sigurd Svendsen. Synthesis and antimicrobial activity of α-aminoboronic-containing peptidomimetics[J]. Journal of Peptide Science, 2013, 20 1: 20-24. DOI: 10.1002/psc.2583 [2] SKYE R. DOERING. Discovery of Nanomolar Melanocortin-3 Receptor (MC3R)-Selective Small Molecule Pyrrolidine Bis-Cyclic Guanidine Agonist Compounds Via a High-Throughput “Unbiased” Screening Campaign[J]. Journal of Medicinal Chemistry, 2021, 64 9: 5577-5592. DOI: 10.1021/acs.jmedchem.0c02041 |
| | (R)-N-Boc-1-Naphthylalanine Preparation Products And Raw materials |
|