|
|
| | (+)-Diisopropyl L-tartrate Basic information |
| Product Name: | (+)-Diisopropyl L-tartrate | | Synonyms: | 2,3-dihydroxy-(R-(R*,R*))-butanedioicacid,bis(1-methylethyl)ester;2,3-dihydroxy-R-R*,R*-butanedioicacid,bis1-methylethylester;2,3-dihydroxy-succinicaciddiisopropylester;Lg-tartaricaciddiisopropylester;Lg-threaricaciddiisopropylester;(2R,3R)-(+)-diisopropyltartrate;(R,R)-2,3-dihydroxy-succinicaciddiisopropylester;L(+)-DIISOPROPYL TARTRATE | | CAS: | 2217-15-4 | | MF: | C10H18O6 | | MW: | 234.25 | | EINECS: | 218-709-0 | | Product Categories: | Asymmetric Synthesis;Chiral Building Blocks;Esters (Chiral);Synthetic Organic Chemistry;CHIRAL CHEMICALS;Hydroxy Acids & Deriv.;Chiral Compound;chiral;API intermediates | | Mol File: | 2217-15-4.mol |  |
| | (+)-Diisopropyl L-tartrate Chemical Properties |
| alpha | 17.25 º (neat) | | Boiling point | 152 °C/12 mmHg (lit.) | | density | 1.114 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.439(lit.) | | Fp | 229 °F | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Viscous Liquid | | pka | 11.70±0.20(Predicted) | | color | Clear colorless | | Specific Gravity | 1.121.114 | | Optical Rotation | [α]24/D +17°, neat | | Sensitive | Hygroscopic | | BRN | 1727863 | | InChI | 1S/C10H18O6/c1-5(2)15-9(13)7(11)8(12)10(14)16-6(3)4/h5-8,11-12H,1-4H3/t7-,8-/m1/s1 | | InChIKey | XEBCWEDRGPSHQH-HTQZYQBOSA-N | | SMILES | CC(C)OC(=O)[C@H](O)[C@@H](O)C(=O)OC(C)C | | CAS DataBase Reference | 2217-15-4(CAS DataBase Reference) | | NIST Chemistry Reference | (+)-Diisopropyl tartrate(2217-15-4) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 24/25-36-26 | | WGK Germany | 3 | | RTECS | WW8100000 | | HS Code | 29181300 | | Storage Class | 10 - Combustible liquids | | Toxicity | mouse,LD50,oral,6300uL/kg (6.3mL/kg),Journal of Pharmacology and Experimental Therapeutics. Vol. 93, Pg. 26, 1948. |
| | (+)-Diisopropyl L-tartrate Usage And Synthesis |
| Chemical Properties | Colorless to light yellow liqui | | Uses | (+)-Diisopropyl L-Tartrate is a reagent for kinetic resolution of racemic allylic alcohols and α-furfuryl amides by enantioselective epoxidation. | | Uses | Both D- and L-forms are reagents for kinetic resolution of racemic allylic alcohols and α-furfuryl amides by enantioselective epoxidation. |
| | (+)-Diisopropyl L-tartrate Preparation Products And Raw materials |
| Raw materials | Nsc402077-->4H-1,3,6,2-Dioxazaborocine, tetrahydro-2-phenyl--->(1S,2S,3R,5S)-(+)-2,3-Pinanediol-->(1R,2R,6S,8R)-2,9,9-Trimethyl-4-phenyl-3,5-dioxa-4-boratricyclo[6.1.1.06]decane-->cis-1,2-Cyclohexanediol-->N-tert-Butyldiethanolamine-->(5,5-DIMETHYL-1,3,2-DIOXABORINAN-2-YL)BENZENE-->neopentyl glycol-->L(+)-Diethyl L-tartrate | | Preparation Products | 2-Phenyl-1,3,2-dioxaborolane-->DIISOPROPYL (R)-(+)-MALATE |
|