- ANTIFOAM PE-L
-
-
2026-04-14
- CAS:9003-13-8
- Min. Order:
- Purity: 0.99
- Supply Ability:
- antifoam pe-l
-
- $1.00 / 1KG
-
2020-02-06
- CAS:9003-13-8
- Min. Order: 1KG
- Purity: Min98% HPLC
- Supply Ability: g/kg/ton
|
| | ANTIFOAM PE-L Basic information |
| | ANTIFOAM PE-L Chemical Properties |
| Boiling point | >200 °C(lit.) | | density | 1 g/mL at 25 °C | | vapor pressure | 0.076Pa at 20℃ | | refractive index | n20/D 1.45 | | Fp | >230 °F | | form | viscous liquid | | Specific Gravity | 1.003 | | Odor | at 100.00%. bland | | Water Solubility | 42.3g/L at 20℃ | | Cosmetics Ingredients Functions | SKIN CONDITIONING SOLVENT HAIR CONDITIONING | | InChI | InChI=1S/C10H22O3/c1-4-5-6-12-8-10(3)13-7-9(2)11/h9-11H,4-8H2,1-3H3 | | InChIKey | CUVLMZNMSPJDON-UHFFFAOYSA-N | | SMILES | C(OC(C)COCCCC)C(O)C | | LogP | 1.306 (est) | | EPA Substance Registry System | Butoxypolypropylene glycol (9003-13-8) |
| Hazard Codes | Xn | | Risk Statements | 22-36/38 | | WGK Germany | 1 | | RTECS | TR4680000 | | TSCA | TSCA listed | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 | | Hazardous Substances Data | 9003-13-8(Hazardous Substances Data) |
| | ANTIFOAM PE-L Usage And Synthesis |
| Uses | Hydraulic fluids, metal working fluids and lubricants, heat transfer fluids, solder assist fluids, quenchants, lubricants, solvents, plasticizers and foam control agents. | | Flammability and Explosibility | Non flammable | | Toxics Screening Level | The initial threshold screening level (ITSL) for polyalkylene glycol monobutyl ether (Ucon LB-1715) is 160
μg/m3 based on an annual averaging time.
|
| | ANTIFOAM PE-L Preparation Products And Raw materials |
|