|
|
| | 5-FLUOROINDOLE-3-ACETIC ACID Basic information |
| | 5-FLUOROINDOLE-3-ACETIC ACID Chemical Properties |
| Melting point | 139-143°C | | Boiling point | 417.9±30.0 °C(Predicted) | | density | 1.446±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | form | Powder | | pka | 4.41±0.30(Predicted) | | color | Off-white to pink | | InChI | 1S/C10H8FNO2/c11-7-1-2-9-8(4-7)6(5-12-9)3-10(13)14/h1-2,4-5,12H,3H2,(H,13,14) | | InChIKey | GWLLOJBOPVNWNF-UHFFFAOYSA-N | | SMILES | OC(=O)Cc1c[nH]c2ccc(F)cc12 | | CAS DataBase Reference | 443-73-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29339980 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 5-FLUOROINDOLE-3-ACETIC ACID Usage And Synthesis |
| Chemical Properties | Off-white to pink powder | | Uses | 5-Fluoroindole-3-acetic Acid can be used as reactant/reagent for design, synthesis, and biol. evaluation of novel tetrahydroprotoberberine derivatives as selective α1A-adrenoceptor antagonists. | | Definition | ChEBI: 5-Fluoroindole-3-acetic acid is a member of indole-3-acetic acids. |
| | 5-FLUOROINDOLE-3-ACETIC ACID Preparation Products And Raw materials |
|