CYCLOHEXANE-D12 manufacturers
- CYCLOHEXANE-D12
-
- $6.60 / 1KG
-
2019-12-24
- CAS:1735-17-7
- Min. Order: 500g
- Purity: 98%
- Supply Ability: 500G ,1KG , 100KG
|
| | CYCLOHEXANE-D12 Basic information |
| Product Name: | CYCLOHEXANE-D12 | | Synonyms: | Cyclohexane-d{12}, Isotopic;1,1,2,2,3,3,4,4,5,5,6,6-dodecadeuteriocyclohexane;CYCLOHEXANE-D12 DEUTERATION MAGNISOLV(TM;Cyclohexane-d12, 99.7 AtoM Percent D;(2H12)Cyclohexane;CYCLOHEXANE-D12,99.5ATOM%D,PACKAGEDIN1MLAMPULES;DODECADEUTEROCYCLOHEXANE;CYCLOHEXANE-D12 | | CAS: | 1735-17-7 | | MF: | C6D12 | | MW: | 96.23 | | EINECS: | 217-077-3 | | Product Categories: | Labware;NMR;NMR Solvents;NMR Solvents and Reagents;Routine NMR;Solvent by Application;Solvents;Solvents for High Throughput NMR;Spectroscopy Solvents (IR;Stable Isotopes;Tubes and Accessories;UV/Vis);Alphabetical Listings;CStable Isotopes;NMR - Solvents;NMR Solvents and Reagents;NMRStable Isotopes;Stable Isotopes;Cyclohexane-d12;Aldrich High Purity NMR Solvents for Routine NMR;Alphabetical Listings;C;High Throughput NMR | | Mol File: | 1735-17-7.mol |  |
| | CYCLOHEXANE-D12 Chemical Properties |
| Melting point | 6,47°C | | Melting point | 6.5°C | | Boiling point | 80.7 °C(lit.) | | Boiling point | 80,7°C | | density | d = 0,89 | | density | 0.893 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.421(lit.) | | Fp | −1 °F | | storage temp. | Flammables area | | solubility | 55mg/l insoluble | | form | Liquid | | color | Clear colorless | | explosive limit | 1.2-8.3%(V) | | Water Solubility | Insoluble in water. | | BRN | 1908842 | | Stability: | Stable. Highly flammable. Readily forms explosive mixtures with air. Note low flash point. Protect from moisture. Incompatible with strong oxidizing agents. | | InChI | InChI=1S/C6H12/c1-2-4-6-5-3-1/h1-6H2/i1D2,2D2,3D2,4D2,5D2,6D2 | | InChIKey | XDTMQSROBMDMFD-LBTWDOQPSA-N | | SMILES | C1([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C1([2H])[2H] | | CAS DataBase Reference | 1735-17-7(CAS DataBase Reference) |
| Hazard Codes | F,Xn,N | | Risk Statements | 11-38-50/53-65-67 | | Safety Statements | 9-16-25-33-60-61-62-51 | | RIDADR | UN 1145 3/PG 2 | | WGK Germany | 3 | | F | 9 | | HazardClass | 3 | | PackingGroup | II | | HS Code | 29021100 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1
Asp. Tox. 1
Flam. Liq. 2
Skin Irrit. 2
STOT SE 3 |
| | CYCLOHEXANE-D12 Usage And Synthesis |
| Chemical Properties | colourless liquid with mild odour | | Uses | It is a common?solvent?used in?NMR spectroscopy. | | General Description | Cyclohexane-d12, a deuterated cyclohexane, is a standard purity solvent useful for routine NMR (Nuclear Magnetic Resonance) studies. Its infrared (vapor and liquid phase in the range of 376-4000cm-1) and Raman (liquid phase) spectral investigations have been reported. Ring inversion of cyclohexane-d12 has been studied by recording its deuterium NMR spectrum in the temperature range -36 to +115°C. It can be prepared by reacting benzene-d6 and deuterium. |
| | CYCLOHEXANE-D12 Preparation Products And Raw materials |
|