|
|
| | DISODIUM TEREPHTHALATE Basic information |
| | DISODIUM TEREPHTHALATE Chemical Properties |
| storage temp. | Store at room temperature, keep dry and cool | | form | Powder | | color | White to Almost white | | Water Solubility | Soluble in water. | | InChI | InChI=1S/C8H6O4.Na.H/c9-7(10)5-1-2-6(4-3-5)8(11)12;;/h1-4H,(H,9,10)(H,11,12);; | | InChIKey | XZUZNAAGTKNXMJ-UHFFFAOYSA-N | | SMILES | C(C1C=CC(C(=O)O)=CC=1)(=O)O.[NaH] |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | 2 | | RTECS | WZ1400000 | | HS Code | 2917.36.0000 |
| | DISODIUM TEREPHTHALATE Usage And Synthesis |
| Uses | Disodium terephthalate and its various derivatives are synthesized via simple acid-base chemistry for anode materials in Na ion batteries. They show excellent electrochemical performance, including little capacity fading over 90 cycles, ideal redox potential, and excellent rate performance, making them promising candidates for Na ion batteries. |
| | DISODIUM TEREPHTHALATE Preparation Products And Raw materials |
|