|
|
| | 2-Amino-4'-fluorobenzophenone Basic information |
| | 2-Amino-4'-fluorobenzophenone Chemical Properties |
| Melting point | 122-128°C | | Boiling point | 390.6±27.0 °C(Predicted) | | density | 1.236±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | form | Solid | | pka | -0.19±0.10(Predicted) | | color | Light Yellow to Yellow | | InChI | InChI=1S/C13H10FNO/c14-10-7-5-9(6-8-10)13(16)11-3-1-2-4-12(11)15/h1-8H,15H2 | | InChIKey | FFFXIQFESQNINT-UHFFFAOYSA-N | | SMILES | C(C1=CC=CC=C1N)(C1=CC=C(F)C=C1)=O | | CAS DataBase Reference | 3800-06-4(CAS DataBase Reference) |
| Safety Statements | 24/25 | | HS Code | 29223990 |
| | 2-Amino-4'-fluorobenzophenone Usage And Synthesis |
| Chemical Properties | Yellow Solid | | Uses | An intermediate in the preparation of the anticholesteremic Pitavastatin. |
| | 2-Amino-4'-fluorobenzophenone Preparation Products And Raw materials |
|