|
|
| | 4'-Methylbiphenyl-2-carboxylic acid Basic information |
| | 4'-Methylbiphenyl-2-carboxylic acid Chemical Properties |
| Melting point | 146-148°C | | Boiling point | 354.5±11.0 °C(Predicted) | | density | 1.156±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO, Methanol | | pka | 3.90±0.36(Predicted) | | form | Solid | | color | White | | InChI | InChI=1S/C14H12O2/c1-10-6-8-11(9-7-10)12-4-2-3-5-13(12)14(15)16/h2-9H,1H3,(H,15,16) | | InChIKey | ZSTUEICKYWFYIC-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(C)C=C2)=CC=CC=C1C(O)=O | | CAS DataBase Reference | 7148-03-0(CAS DataBase Reference) | | EPA Substance Registry System | [1,1'-Biphenyl]-2-carboxylic acid, 4'-methyl- (7148-03-0) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Hazard Note | Irritant | | TSCA | TSCA listed | | HS Code | 29163990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 4'-Methylbiphenyl-2-carboxylic acid Usage And Synthesis |
| Chemical Properties | Light yellow solid | | Uses | 4’-Methylbiphenyl-2-carboxylic Acid is used in the synthesis of angiotensin II receptor antagonists used as potent orally active antihypertensives. | | General Description | 4′-Methyl-2-biphenylcarboxylic acid (4′-Methyl-bi-phenyl-2-carboxyl-ic acid) can be synthesized by reacting 4′-methylbiphenyl-2-carbonitrile with methanol and 30% NaOH solution. Its crystal structure has been characterized by the centrosymmetric hydrogen-bonded dimers. | | Purification Methods | Crystallise the acid from toluene or *C6H6 (m 147-148o). [Beilstein 9 H 677, 9 IV 2523.] |
| | 4'-Methylbiphenyl-2-carboxylic acid Preparation Products And Raw materials |
|