| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:rac Ketoprofen-d3
CAS:159490-55-8
Package:10Mg,1Mg
|
| Company Name: |
Daicel Chiral Technologies (China)CO.,LTD
|
| Tel: |
021-50460086-9 15921403865 |
| Email: |
han_yajun@dctc.daicel.com |
| Products Intro: |
Product Name:Ketoprofen-D3
CAS:159490-55-8
Purity:95%HPLC Package:10MG;25MG;50MG;100MG Remarks:DCTI-A-213
|
| Company Name: |
ShangHai YuanYe Biotechnology Co., Ltd.
|
| Tel: |
021-61312847 13636370518 |
| Email: |
shyysw007@163.com |
| Products Intro: |
Product Name:rac Ketoprofen-d3
CAS:159490-55-8
Purity:98% Package:1mg Remarks:B29431
|
| Company Name: |
Cato Research Chemicals Inc.
|
| Tel: |
020-81960175 |
| Email: |
min.he@cato-chem.com |
| Products Intro: |
Product Name:rac Ketoprofen-d3
CAS:159490-55-8
Purity:95% Package:25Mg, 50Mg
|
|
| | KETOPROFEN-D3 Basic information |
| Product Name: | KETOPROFEN-D3 | | Synonyms: | KETOPROFEN-D3;rac Ketoprofen-d3;Ketoprofen-d3;DKYWVDODHFEZIM-FIBGUPNXSA-N;2-(3-benzoylphenyl)-3,3,3-trideuteriopropanoic acid;D3-Ketoprofen;[2H3]-Ketoprofen;Ketoprofen D3Q: What is
Ketoprofen D3 Q: What is the CAS Number of
Ketoprofen D3 Q: What is the storage condition of
Ketoprofen D3 Q: What are the applications of
Ketoprofen D3 | | CAS: | 159490-55-8 | | MF: | C16H14O3 | | MW: | 254.29 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | KETOPROFEN-D3 Chemical Properties |
| storage temp. | Store at -20°C | | solubility | DMSO: soluble; Methanol: soluble | | form | Solid | | color | White to off-white | | Major Application | forensics and toxicology
pharmaceutical (small molecule)
veterinary | | InChI | 1S/C16H14O3/c1-11(16(18)19)13-8-5-9-14(10-13)15(17)12-6-3-2-4-7-12/h2-11H,1H3,(H,18,19)/i1D3 | | InChIKey | DKYWVDODHFEZIM-FIBGUPNXSA-N | | SMILES | [2H]C([2H])([2H])C(C(O)=O)c1cccc(c1)C(=O)c2ccccc2 |
| Hazard Codes | T | | Risk Statements | 25-36/37/38 | | Safety Statements | 26-45 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | KETOPROFEN-D3 Usage And Synthesis |
| Uses | (Ketoprofen-d3) Labeled Ketoprofen, intended for use as an internal standard for the quantification of Ketoprofen by GC- or LC-mass spectrometry. |
| | KETOPROFEN-D3 Preparation Products And Raw materials |
|