|
|
| | Chloro-N,N,N′,N′-tetramethylformamidinium hexafluorophosphate Basic information |
| Product Name: | Chloro-N,N,N′,N′-tetramethylformamidinium hexafluorophosphate | | Synonyms: | CHLORO-N,N,N,N-TETRAMETHYLFORMA-MIDINIUM PF6;Chloro-N,N,N',N'-tetramethylformamidiniumhexafluo;N,N,N',N'-Tetramethylchloroformamidinium-hexafluorophosphate;Chloro-N,N,N′,N′-tetraMethylforMaMidiniuM hexafluorophosphate, >=98.0%;TCFH, >=98.0%;TCFH N,N,N‘,N‘-Tetramethylchloroformamidinium-hexafluorophosphe;Chloro-N,N,N',N'-tetramethylformamidinium hexafluorophosphate >=98.0% (T);[chloro(dimethylamino)methylidene]-dimethylammonium hexafluorophosphate | | CAS: | 207915-99-9 | | MF: | C5H12ClF6N2P | | MW: | 280.58 | | EINECS: | 627-919-5 | | Product Categories: | Coupling;Peptide Synthesis;Phosphonium/Uronium/Formamidinium;Phosphonium/Uronium/FormamidiniumSynthetic Reagents | | Mol File: | 207915-99-9.mol |  |
| | Chloro-N,N,N′,N′-tetramethylformamidinium hexafluorophosphate Chemical Properties |
| Melting point | 99-104 °C | | storage temp. | 2-8°C | | solubility | DMSO, Methanol | | form | Powder | | color | White to off-white | | BRN | 7896715 | | InChI | InChI=1S/C5H12ClN2.F6P/c1-7(2)5(6)8(3)4;1-7(2,3,4,5)6/h1-4H3;/q+1;-1 | | InChIKey | CUKNPSDEURGZCO-UHFFFAOYSA-N | | SMILES | C(/Cl)(=[N+](\C)/C)\N(C)C.[P-](F)(F)(F)(F)(F)F |
| | Chloro-N,N,N′,N′-tetramethylformamidinium hexafluorophosphate Usage And Synthesis |
| Uses | Chloro-N,N,N′,N′-tetramethylformamidinium hexafluorophosphate can be used as a reactant for the synthesis of:
- Onium salts for use in peptide coupling.
- Benzotriazole based uranium reagent, a safer replacement for coupling reagents.
It can also be used as a reagent for the synthesis of:
- Cancer cell cytotoxins.
- Bioconjugation reagents.
|
| | Chloro-N,N,N′,N′-tetramethylformamidinium hexafluorophosphate Preparation Products And Raw materials |
|