- (2-bromophenyl)methanol
-
- $0.00 / 200kg
-
2026-04-22
- CAS:18982-54-2
- Min. Order: 20kg
- Purity: 99%
- Supply Ability: 20 tons
- 2-Bromobenzyl alcohol
-
- $0.00 / 25KG
-
2025-06-27
- CAS:18982-54-2
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 500000kg
- 2-Bromobenzyl alcohol
-
- $15.00 / 1kg
-
2025-06-20
- CAS:18982-54-2
- Min. Order: 1kg
- Purity: 0.99
- Supply Ability: 20 tons
|
| | 2-Bromobenzyl alcohol Basic information |
| | 2-Bromobenzyl alcohol Chemical Properties |
| Melting point | 78-80 °C (lit.) | | Boiling point | 220.79°C (rough estimate) | | density | 1.3839 (rough estimate) | | refractive index | 1.5840 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO, Methanol | | form | Solid | | pka | 13.95±0.10(Predicted) | | color | White | | BRN | 2243418 | | InChI | InChI=1S/C7H7BrO/c8-7-4-2-1-3-6(7)5-9/h1-4,9H,5H2 | | InChIKey | IOWGHQGLUMEZKG-UHFFFAOYSA-N | | SMILES | C1(CO)=CC=CC=C1Br | | CAS DataBase Reference | 18982-54-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 52/53-22 | | Safety Statements | 24/25 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29062900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
| | 2-Bromobenzyl alcohol Usage And Synthesis |
| Chemical Properties | WHITE TO BEIGE CRYSTALLINE POWDER OR NEEDLES | | Uses | 2-Bromobenzyl alcohol was used in microwave assisted palladium-catalyzed synthesis of phthalides. It was also used in the synthesis of 1-hydroxy-3(1H)-l,2-benzoboroxole. | | Synthesis Reference(s) | Tetrahedron Letters, 26, p. 3365, 1985 DOI: 10.1016/S0040-4039(00)98299-6 |
| | 2-Bromobenzyl alcohol Preparation Products And Raw materials |
|