|
| 4-Pentyldicyclohexylanone Basic information |
| 4-Pentyldicyclohexylanone Chemical Properties |
Boiling point | 341.6±10.0 °C(Predicted) | density | 0.926±0.06 g/cm3(Predicted) | storage temp. | Sealed in dry,Room Temperature | InChI | InChI=1S/C17H30O/c1-2-3-4-5-14-6-8-15(9-7-14)16-10-12-17(18)13-11-16/h14-16H,2-13H2,1H3/t14-,15- | InChIKey | OZLFNAZSDVXEFU-SHTZXODSSA-N | SMILES | C1([C@@H]2CC[C@@H](CCCCC)CC2)CCC(=O)CC1 | CAS DataBase Reference | 84868-02-0(CAS DataBase Reference) |
| 4-Pentyldicyclohexylanone Usage And Synthesis |
Chemical Properties | light yellow liquid | Uses | Intermediates of Liquid Crystals |
| 4-Pentyldicyclohexylanone Preparation Products And Raw materials |
|