1,8-Diiodoperfluorooctane manufacturers
|
| | 1,8-Diiodoperfluorooctane Basic information |
| Product Name: | 1,8-Diiodoperfluorooctane | | Synonyms: | 1,8-DIIODOPERFLUOROOCTANE;HEXADECAFLUORO-1,8-DIIODOOCTANE;1,8-Diiodoperfluorooctane 98%;1,8-Diiodoperfluorooctane98%;Perfluoro-1,8-diiodooctane 98%;Hexadecafluoro-1,8-diiodooctane 98%;Perfluoro-1,8-diiodooctane98%;Octane, 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluoro-1,8-diiodo- | | CAS: | 335-70-6 | | MF: | C8F16I2 | | MW: | 653.87 | | EINECS: | | | Product Categories: | Alkyl;Halogenated Hydrocarbons;Organic Building Blocks;Alkyl Fluorinated Building Blocks;Building Blocks;Chemical Synthesis;Fluorinated Building Blocks;Halogenated Hydrocarbons;Organic Building Blocks;Organic Fluorinated Building Blocks;Other Fluorinated Organic Building Blocks | | Mol File: | 335-70-6.mol |  |
| | 1,8-Diiodoperfluorooctane Chemical Properties |
| Melting point | 73-77 °C (lit.) | | Boiling point | 112°C 25mm | | density | 2.2482 (estimate) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | InChI | InChI=1S/C8F16I2/c9-1(10,3(13,14)5(17,18)7(21,22)25)2(11,12)4(15,16)6(19,20)8(23,24)26 | | InChIKey | SRDQTCUHAMDAMG-UHFFFAOYSA-N | | SMILES | C(F)(F)(I)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)I | | CAS DataBase Reference | 335-70-6(CAS DataBase Reference) | | EPA Substance Registry System | 1,8-Diiodoperfluorooctane (335-70-6) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2903780090 | | Storage Class | 11 - Combustible Solids |
| | 1,8-Diiodoperfluorooctane Usage And Synthesis |
| Uses | 1,8-Diiodoperfluorooctane (CAS# 335-70-6) is a perfluoroalkane used in the synthesis of semifluorinated polymers, and other perflourinated species. |
| | 1,8-Diiodoperfluorooctane Preparation Products And Raw materials |
|