- Boc-D-Tyr(bzl)-OH
-
- $0.00/ kg
-
2026-04-30
- CAS:63769-58-4
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T
- BOC-D-TYR(BZL)-OH
-
- $10.00 / 1KG
-
2019-07-06
- CAS:63769-58-4
- Min. Order: 10KG
- Purity: 99%
- Supply Ability: 100kg
|
| | BOC-D-TYR(BZL)-OH Basic information |
| Product Name: | BOC-D-TYR(BZL)-OH | | Synonyms: | N-ALPHA-T-BOC-O-BENZYL-D-TYROSINE;N-ALPHA-T-BUTOXYCARBONYL-O-BENZYL-D-TYROSINE;N-ALPHA-TERT-BUTYLOXYCARBONYL-O-BENZYL-D-TYROSINE;2-[[(2-methylpropan-2-yl)oxy-oxomethyl]amino]-3-(4-phenylmethoxyphenyl)propanoic acid;(2R)-3-[4-(benzyloxy)phenyl]-2-{[(tert-butoxy)carbonyl]amino}propanoic acid;BOC-D-TYROSINE(BZL)-OH;BOC-D-TYR(BZL)-OH;BOC-(R)-2-AMINO-3-(4'-BENZYLOXYPHENYL)PROPANOIC ACID | | CAS: | 63769-58-4 | | MF: | C21H25NO5 | | MW: | 371.43 | | EINECS: | | | Product Categories: | Amino Acid Derivatives;Amino Acids | | Mol File: | 63769-58-4.mol |  |
| | BOC-D-TYR(BZL)-OH Chemical Properties |
| Boiling point | 552.4±50.0 °C(Predicted) | | density | 1.185±0.06 g/cm3(Predicted) | | storage temp. | Store below +30°C. | | pka | 2.99±0.10(Predicted) | | form | Solid | | Appearance | White to off-white Solid | | Water Solubility | Slightly soluble in water. | | Major Application | peptide synthesis | | InChI | 1S/C21H25NO5/c1-21(2,3)27-20(25)22-18(19(23)24)13-15-9-11-17(12-10-15)26-14-16-7-5-4-6-8-16/h4-12,18H,13-14H2,1-3H3,(H,22,25)(H,23,24) | | InChIKey | ZAVSPTOJKOFMTA-UHFFFAOYSA-N | | SMILES | N(C(Cc1ccc(cc1)OCc2ccccc2)C(=O)O)C(=O)OC(C)(C)C | | CAS DataBase Reference | 63769-58-4(CAS DataBase Reference) |
| WGK Germany | WGK 2 | | Storage Class | 11 - Combustible Solids |
| | BOC-D-TYR(BZL)-OH Usage And Synthesis |
| Chemical Properties | White to of-white powder | | Uses | N-Boc-O-benzyl-D-tyrosine is used as a intermediate for pharmaceutical and chemical research. | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | BOC-D-TYR(BZL)-OH Preparation Products And Raw materials |
|