- Zinc(II) acetylacetonate
-
- $0.00 / 1G/KG
-
2026-02-15
- CAS:14024-63-6
- Min. Order: 1G/KG
- Purity: 99%
- Supply Ability: 100000000KG
|
| | Zinc(II) acetylacetonate Basic information |
| | Zinc(II) acetylacetonate Chemical Properties |
| Melting point | 124-126 °C | | Boiling point | 129-131 °C (10 mmHg) | | bulk density | 500kg/m3 | | density | 1.544[at 20℃] | | vapor pressure | 0Pa at 25℃ | | storage temp. | Store below +30°C. | | solubility | soluble in Methanol | | pka | 8.8[at 20 ℃] | | form | Powder | | color | White to ivory | | PH | 10 (20°C, 4g/L in H2O) | | Water Solubility | 9.1g/L at 20℃ | | Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions | | InChI | 1S/2C5H7O2.Zn/c2*1-4(6)3-5(2)7;/h2*3H,1-2H3;/q2*-1;+2 | | InChIKey | NHXVNEDMKGDNPR-UHFFFAOYSA-N | | SMILES | [Zn+2].O=C([C-H]C(=O)C)C.O=C([C-H]C(=O)C)C | | LogP | 0.2 at 22℃ | | CAS DataBase Reference | 14024-63-6(CAS DataBase Reference) | | NIST Chemistry Reference | Bis(acetylacetonato)zinc(14024-63-6) | | EPA Substance Registry System | Zinc, bis(2,4-pentanedionato-.kappa.O2,.kappa.O4)-, (T-4)- (14024-63-6) |
| Hazard Codes | Xn | | Risk Statements | 22-36-36/37/38 | | Safety Statements | 20-39-37/39-26 | | WGK Germany | WGK 1 | | RTECS | ZH0917500 | | Autoignition Temperature | 580°C | | TSCA | TSCA listed | | HS Code | 29141900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 2 Eye Irrit. 2 Skin Sens. 1B |
| Provider | Language |
|
ALFA
| English |
| | Zinc(II) acetylacetonate Usage And Synthesis |
| Chemical Properties | White to ivory powder | | Uses | Catalyst in synthesis of long-chain alcohols and
aldehydes, textile weighting agent. | | Flammability and Explosibility | Not classified | | Purification Methods | The zinc complex crystallises from hot 95% EtOH. [Fernelius & Bryant Inorg Synth V 105 1957, Wakita et al. J Organometal Chem 301 C17 1986, Beilstein 2 IV 144.] |
| | Zinc(II) acetylacetonate Preparation Products And Raw materials |
|