Related articles - What is Tin(II) methanesulfonate?
- Tin(II) methanesulfonate is used in electroplating industry. Tin methanesulfonate is an aqueous solution used in the metal sur....
- Jan 6，2020
|
| | Stannous methanesulfonate Basic information |
| | Stannous methanesulfonate Chemical Properties |
| Melting point | -27°C | | density | 1.55 | | refractive index | 1.444 | | Specific Gravity | 1.550 | | Water Solubility | Not miscible or difficult to mix in water. | | Hydrolytic Sensitivity | 0: forms stable aqueous solutions | | Sensitive | Air Sensitive | | Exposure limits | ACGIH: TWA 0.1 mg/m3; STEL 0.2 mg/m3 (Skin)
NIOSH: IDLH 25 mg/m3; TWA 0.1 mg/m3 | | InChI | InChI=1S/2CH4O3S.Sn/c2*1-5(2,3)4;/h2*1H3,(H,2,3,4);/q;;+2/p-2 | | InChIKey | JALQQBGHJJURDQ-UHFFFAOYSA-L | | SMILES | S(=O)(=O)(C)[O-].S([O-])(=O)(=O)C.[Sn+2] | | CAS DataBase Reference | 53408-94-9(CAS DataBase Reference) | | EPA Substance Registry System | Methanesulfonic acid, tin(2+) salt (53408-94-9) |
| Hazard Codes | C,N | | Risk Statements | 22-34-43-51/53 | | Safety Statements | 22-26-36/37/39-45-61 | | RIDADR | UN 3265 | | WGK Germany | 1 | | TSCA | TSCA listed | | HazardClass | 8 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Aquatic Chronic 2
Skin Corr. 1B
Skin Sens. 1 |
| | Stannous methanesulfonate Usage And Synthesis |
| Chemical Properties | Colorless transparent liquid | | Uses | It is used in electroplating industry. Tin methanesulfonate is an aqueous solution used in the metal surface treatment. Mainly as a replacement for Tin sulfate where high speed deposits are needed (reel-to-reel). | | reaction suitability | core: tin
reagent type: catalyst |
| | Stannous methanesulfonate Preparation Products And Raw materials |
|