| Company Name: |
Energy Chemical Gold
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:1-(Phenyl-d5)ethanone CAS:28077-64-7 Purity:99%,D 98% Package:1g Remarks:NULL
|
| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:Acetophenone-2',3',4',5',6'-D5 >99.0 AtoM % D CAS:28077-64-7 Package:5g
|
|
| | ACETOPHENONE-2',3',4',5',6'-D5 Basic information |
| | ACETOPHENONE-2',3',4',5',6'-D5 Chemical Properties |
| Melting point | 19-20 °C(lit.) | | Boiling point | 202 °C(lit.) | | density | 1.073 g/mL at 25 °C | | refractive index | n20/D 1.5335(lit.) | | Fp | 180 °F | | storage temp. | Refrigerator | | solubility | soluble in Chloroform, Ethyl Acetate | | form | liquid | | color | Colourless | | Sensitive | Hygroscopic | | InChI | InChI=1S/C8H8O/c1-7(9)8-5-3-2-4-6-8/h2-6H,1H3/i2D,3D,4D,5D,6D | | InChIKey | KWOLFJPFCHCOCG-VIQYUKPQSA-N | | SMILES | C1(C(=O)C)=C([2H])C(=C([2H])C([2H])=C1[2H])[2H] | | EPA Substance Registry System | Acetophenone-d5 (28077-64-7) | | CAS Number Unlabeled | 98-86-2 |
| Hazard Codes | Xn | | Risk Statements | 22-36 | | Safety Statements | 26 | | RIDADR | UN 3334 | | WGK Germany | 3 | | HS Code | 2845901000 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
| | ACETOPHENONE-2',3',4',5',6'-D5 Usage And Synthesis |
| Chemical Properties | Colourless Liquid | | Uses | (Acetophenone-2',3',4',5',6'-D5) Labeled Acetophenone, intended for use as an internal standard for the quantification of Acetophenoneby GC- or LC-mass spectrometry. | | Uses | Deuterium labelled form of acetophenone, a reagent used in the production of fragrances and resin polymers. |
| | ACETOPHENONE-2',3',4',5',6'-D5 Preparation Products And Raw materials |
|