| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- 2-BROMO-CYCLOHEXANONE
-
- $9.00
-
2026-05-28
- CAS:822-85-5
- Min. Order: 1KG
- Purity: 99.8%
- Supply Ability: 100tons
|
| | 2-Bromo-cyclohexanone Basic information |
| Product Name: | 2-Bromo-cyclohexanone | | Synonyms: | 2-Bromocyclohexanone (±)-form;2-BROMO-CYCLOHEXANONE 95 % GC, 95%;2-BroMocyclohexanone >=90% (GC);2-bromo-1-cyclohexanone;2-Bromocyclohexanone,>98%;Cyclohexanone, 2-bromo-;2-Bromocyclohexan-1-one (stabilized with HQ + CaCO3);TIANFUCHEM--822-85-5--2-BROMO-CYCLOHEXANONE in stock | | CAS: | 822-85-5 | | MF: | C6H9BrO | | MW: | 177.04 | | EINECS: | | | Product Categories: | API intermediates | | Mol File: | 822-85-5.mol |  |
| | 2-Bromo-cyclohexanone Chemical Properties |
| Boiling point | 89-90 °C(Press: 14 Torr) | | density | 1.3400 | | refractive index | 1.516 | | storage temp. | -20°C | | form | liquid | | Appearance | Colorless to light yellow Liquid | | BRN | 1071730 | | InChI | InChI=1S/C6H9BrO/c7-5-3-1-2-4-6(5)8/h5H,1-4H2 | | InChIKey | KDXYEWRAWRZXFT-UHFFFAOYSA-N | | SMILES | C1(=O)CCCCC1Br |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-43 | | Safety Statements | 26-36/37 | | RIDADR | UN 3334 | | WGK Germany | 3 | | HS Code | 2914790090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |
| | 2-Bromo-cyclohexanone Usage And Synthesis |
| | 2-Bromo-cyclohexanone Preparation Products And Raw materials |
|