2,2-Difluoro-benzo[1,3]dioxole-5-boronic acid manufacturers
|
| | 2,2-Difluoro-benzo[1,3]dioxole-5-boronic acid Basic information |
| Product Name: | 2,2-Difluoro-benzo[1,3]dioxole-5-boronic acid | | Synonyms: | 2,2-DIFLUORO-BENZO[1,3]DIOXOLE-5-BORONIC ACID;2,2-difluoro-1,3-benzodioxol-5-yl boronic acid;2,2-Difluoro-1,3-benzodioxole-5-boronic acid;(2,2-Difluorobenzo[d][1,3]dioxol-5-yl)boronic acid;Boronic acid,B-(2,2-difluoro-1,3-benzodioxol-5-yl)-;(2,2-difluoro-2H-1,3-benzodioxol-5-yl)boronic acid;2,2-Difluoro-benzo[1,3]dioxole-5-boronic;(2,2-difluoro-2H-1,3-benzodioxol-5-yl)boronic acid(contains varying amounts of Anhydride) | | CAS: | 190903-71-0 | | MF: | C7H5BF2O4 | | MW: | 201.92 | | EINECS: | | | Product Categories: | | | Mol File: | 190903-71-0.mol | ![2,2-Difluoro-benzo[1,3]dioxole-5-boronic acid Structure](CAS/GIF/190903-71-0.gif) |
| | 2,2-Difluoro-benzo[1,3]dioxole-5-boronic acid Chemical Properties |
| Boiling point | 288.0±50.0 °C(Predicted) | | density | 1.58±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,2-8°C | | pka | 8.25±0.40(Predicted) | | form | solid | | Appearance | White to off-white Solid | | InChI | InChI=1S/C7H5BF2O4/c9-7(10)13-5-2-1-4(8(11)12)3-6(5)14-7/h1-3,11-12H | | InChIKey | OTTIPUIRDXSIBG-UHFFFAOYSA-N | | SMILES | B(C1=CC=C2OC(F)(F)OC2=C1)(O)O |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | WGK 3 | | HS Code | 2932990090 | | Storage Class | 11 - Combustible Solids |
| | 2,2-Difluoro-benzo[1,3]dioxole-5-boronic acid Usage And Synthesis |
| Uses | 2,2-Difluoro-benzo[1,3]dioxole-5-boronic acid is an organic boron compound that can be used as a synthetic pharmaceutical intermediate for small-molecule active inhibitors. |
| | 2,2-Difluoro-benzo[1,3]dioxole-5-boronic acid Preparation Products And Raw materials |
|