|
|
| | 2-Methyl-1-pyridin-2-yl-propylamine dihydrochloride Basic information |
| | 2-Methyl-1-pyridin-2-yl-propylamine dihydrochloride Chemical Properties |
| form | solid | | InChI | 1S/C9H14N2.2ClH/c1-7(2)9(10)8-5-3-4-6-11-8;;/h3-7,9H,10H2,1-2H3;2*1H | | InChIKey | WQMCWVFMBPRHJX-UHFFFAOYSA-N | | SMILES | NC(C(C)C)C1=CC=CC=N1.[H]Cl.[H]Cl |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 2-Methyl-1-pyridin-2-yl-propylamine dihydrochloride Usage And Synthesis |
| | 2-Methyl-1-pyridin-2-yl-propylamine dihydrochloride Preparation Products And Raw materials |
|