| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | BUTTPARK 16\06-64 Basic information |
| Product Name: | BUTTPARK 16\06-64 | | Synonyms: | BUTTPARK 16\06-64;2-Acetamido-4-(2-hydroxyphenyl)thiazole;N-[4-(2-hydroxyphenyl)-1,3-thiazol-2-yl]acetamide;2-Acetamido-4-(2-hydroxyphenyl)thiazole,97%;N-(4-(2-hydroxyphenyl)thiazol-2-yl)acetamide | | CAS: | 78546-66-4 | | MF: | C11H10N2O2S | | MW: | 234.2743 | | EINECS: | | | Product Categories: | | | Mol File: | 78546-66-4.mol |  |
| | BUTTPARK 16\06-64 Chemical Properties |
| Melting point | 224-228° | | form | solid | | InChI | 1S/C11H10N2O2S/c1-7(14)12-11-13-9(6-16-11)8-4-2-3-5-10(8)15/h2-6,15H,1H3,(H,12,13,14) | | InChIKey | RCVLPHKAZAQDGZ-UHFFFAOYSA-N | | SMILES | CC(NC1=NC(C2=C(O)C=CC=C2)=CS1)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
| | BUTTPARK 16\06-64 Usage And Synthesis |
| | BUTTPARK 16\06-64 Preparation Products And Raw materials |
|