|
|
| | 2-Amino-3-methylpyrazine Basic information |
| Product Name: | 2-Amino-3-methylpyrazine | | Synonyms: | 3-METHYLPYRAZIN-2-YLAMINE;2-AMINO-3-METHYLPYRAZINE;3-methylpyrazin-2-amine;3-Methyl-2-pyrazinamine;2-Pyrazinamine,3-methyl-;(S)-HEXAHYDROPYRRO...;2-Methyl-3-aMinopyrazine;3-Methylpyrazin-2-amine 97% | | CAS: | 19838-08-5 | | MF: | C5H7N3 | | MW: | 109.13 | | EINECS: | | | Product Categories: | Piperazines | | Mol File: | 19838-08-5.mol |  |
| | 2-Amino-3-methylpyrazine Chemical Properties |
| Melting point | 165-167 °C | | Boiling point | 194.6°C (rough estimate) | | density | 1.1118 (rough estimate) | | refractive index | 1.5340 (estimate) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 3.56±0.10(Predicted) | | form | Solid | | Appearance | White to yellow Solid | | InChI | InChI=1S/C5H7N3/c1-4-5(6)8-3-2-7-4/h2-3H,1H3,(H2,6,8) | | InChIKey | VQPHZDDLWFHRHR-UHFFFAOYSA-N | | SMILES | C1(N)=NC=CN=C1C |
| | 2-Amino-3-methylpyrazine Usage And Synthesis |
| Pharmaceutical Applications | 2-Amino-3-methylpyrazine is utilized in medicinal chemistry as a scaffold for developing bioactive molecules, such as kinases and potential antiviral agents. | | Synthesis | The general procedure for the synthesis of 2-amino-3-methylpyrazine from 2-chloro-3-methylpyrazine was as follows: a mixture of 2-chloro-3-methylpyrazine (7 g, 54.69 mmol) and 25% ammonia (100 mL) was placed in a sealed tube, heated to 160 °C and reacted for 24 hours. After completion of the reaction, the mixture was cooled to room temperature and extracted with ethyl acetate (3 x 200 mL). The organic phases were combined, dried over anhydrous sodium sulfate, and subsequently concentrated under reduced pressure to give 2.18 g (89% yield) of 3-methylpyrazin-2-amine as a yellow solid. m/z 110 ([M+H]+) by LCMS. | | References | [1] Patent: WO2009/29625, 2009, A1. Location in patent: Page/Page column 67
[2] Patent: WO2005/120513, 2005, A1. Location in patent: Page/Page column 15; 16
[3] Patent: WO2006/131003, 2006, A1. Location in patent: Page/Page column 17
[4] Synthesis, 1994, # 9, p. 931 - 934
[5] Patent: WO2010/83617, 2010, A1. Location in patent: Page/Page column 62 |
| | 2-Amino-3-methylpyrazine Preparation Products And Raw materials |
|