|
|
| | 1,1'-BIS(DICYCLOHEXYLPHOSPHINO)FERROCENE Basic information | | Reaction |
| Product Name: | 1,1'-BIS(DICYCLOHEXYLPHOSPHINO)FERROCENE | | Synonyms: | 1,1'-Bis(dicyclohexylphosphino)ferrocene, min. 98%;1,1'-Bis(dicyclohexylphosphiNA)ferrocene;1,1'-Bis(dicyclohexylphosphino;1,1'-Bis(dicyclohexylphosphino)ferrocene,98%;1,1'-Bis(dicyclohexylphosphino)ferrocene,Min.98%;Dicyclohexyl(cyclopentyl)phosphane;1,1'-Bis(dicycL;Ferrocene, 1,1'-bis(dicyclohexylphosphino)- | | CAS: | 146960-90-9 | | MF: | C34H44FeP2 | | MW: | 570.52 | | EINECS: | 623-251-3 | | Product Categories: | Achiral Phosphine;Aryl Phosphine | | Mol File: | 146960-90-9.mol |  |
| | 1,1'-BIS(DICYCLOHEXYLPHOSPHINO)FERROCENE Chemical Properties |
| Melting point | 134-136°C | | storage temp. | Inert atmosphere,Room Temperature | | form | Powder | | color | orange | | InChI | InChI=1S/2C17H22P.Fe/c2*1-3-9-15(10-4-1)18(17-13-7-8-14-17)16-11-5-2-6-12-16;/h2*15-16H,1-6,9-12H2;/q2*-1;+2 | | InChIKey | OYQDKNYBVNMMJN-UHFFFAOYSA-N | | SMILES | P(C1CCCCC1)(C1CCCCC1)[C-]12C3=C4C5=C1[Fe+2]16782345C2C1=C6[C-]7(P(C1CCCCC1)C1CCCCC1)C8=2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 22-24-26-36/37 | | WGK Germany | 3 | | TSCA | No | | HS Code | 2931499090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 1,1'-BIS(DICYCLOHEXYLPHOSPHINO)FERROCENE Usage And Synthesis |
| Reaction |
- Ligand for palladium-catalyzed synthesis of oxindoles by amide ɑ-arylation.
- Ligand for palladium-catalyzed alkoxycarbonylation of aryl chlorides.
- Ligand for ruthenium-catalyzed alcohol-allene C-C coupling reaction via hydrohydroxyalkylation of 1,1-disubstituted allenes employing alcohols.
- Ligand for nickel-catalyzed cross-coupling reaction of arylboronic acids with aryl carbonates.
- Ligand for palladium-catalyzed regiodivergent hydroesterification of aryl olefins with phenyl formate to form linear structured phenyl arylpropanoates.
- Ligand for palladium-catalyzed direct borylation of benzyl alcohol and its analogues in the absence of bases.
| | Chemical Properties | 1,1'-Bis(dicyclohexylphosphino)ferrocene is stable under recommended storage conditions, it reacts with strong oxidizing agents.
| | Uses |
1,1'-Bis(dicyclohexylphosphino)ferrocene is an orange to brown powder, it can be used as an organophosphine ligand.
| | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction
reaction type: Heck Reaction
reaction type: Hiyama Coupling
reaction type: Negishi Coupling
reaction type: Sonogashira Coupling
reaction type: Stille Coupling
reaction type: Suzuki-Miyaura Coupling
reagent type: ligand |
| | 1,1'-BIS(DICYCLOHEXYLPHOSPHINO)FERROCENE Preparation Products And Raw materials |
|