- Fmoc-L-Dapa-OH
-
- $1.00 / 1KG
-
2019-07-06
- CAS:181954-34-7
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20kg
|
| | Fmoc-L-Dapa-OH Basic information |
| Product Name: | Fmoc-L-Dapa-OH | | Synonyms: | L-ALANINE, 3-AMINO-N-[(9H-FLUOREN-9-YLMETHOXY)CARBONYL]-;N-α-Fmoc-L-2,3-diaminopropionic acid;N-α-Fmoc-L-2,3-diaminopropionic acid hydrochloride;N-alpha-(9-Fluorenylmethyloxycarbonyl)-L-2,3-diaminopropionicacidhydrocholrid;N-ALPHA-(9-FLUOROENYLMETHYLOXYCARBONYL)-L-2,3-DIAMINOPROPIONIC ACID HYDROCHLORID;Fmoc-L-Dap-OH;N-alpha-(9-Fluorenylmethyloxycarbonyl)-L-2,3-diaminopropionic acid;N-.ALPHA. -FMOC-L-2,3-DIAMINOPROPIONIC ACID HYDROCHLORIDE | | CAS: | 181954-34-7 | | MF: | C18H18N2O4 | | MW: | 326.35 | | EINECS: | 1533716-785-6 | | Product Categories: | Unusual Amino Acids;Amino Acid Derivatives | | Mol File: | 181954-34-7.mol |  |
| | Fmoc-L-Dapa-OH Chemical Properties |
| Boiling point | 579.5±50.0 °C(Predicted) | | density | 1.324±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | pka | 2.77±0.16(Predicted) | | form | Powder | | Appearance | White to off-white Solid | | Optical Rotation | Consistent with structure | | BRN | 7658592 | | Major Application | peptide synthesis | | InChI | 1S/C18H18N2O4/c19-9-16(17(21)22)20-18(23)24-10-15-13-7-3-1-5-11(13)12-6-2-4-8-14(12)15/h1-8,15-16H,9-10,19H2,(H,20,23)(H,21,22)/t16-/m0/s1 | | InChIKey | HDSLKWZYHRLRRL-INIZCTEOSA-N | | SMILES | NC[C@H](NC(=O)OCC1c2ccccc2-c3ccccc13)C(O)=O |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 10 | | HazardClass | IRRITANT | | HS Code | 29242990 | | Storage Class | 11 - Combustible Solids |
| | Fmoc-L-Dapa-OH Usage And Synthesis |
| Chemical Properties | solid | | Uses | peptide synthesis | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | Fmoc-L-Dapa-OH Preparation Products And Raw materials |
|