|
|
| | Chloropentafluorobenzene Basic information |
| Product Name: | Chloropentafluorobenzene | | Synonyms: | PENTAFLUOROCHLOROBENZENE;Chloropentafluorobenzene,99%;1-Chloro-2,3,4,5,6-pentafluorobenzene;1-chloro-2,3,4,5,6-pentafluoro-benzene;Pentafluorochlorobenzol;Chloropentafluorobenzene, 99% 5GR;1,2,3,4,5-Pentafluoro-6-chlorobenzene;1-Chloropentafluorobenzene | | CAS: | 344-07-0 | | MF: | C6ClF5 | | MW: | 202.51 | | EINECS: | 206-450-6 | | Product Categories: | Aryl;Halogenated Hydrocarbons;Aromatic Hydrocarbons (substituted) & Derivatives;Halogenated Heterocycles ,Pyrimidines;organofluorine compounds;Aryl Fluorinated Building Blocks;Building Blocks;Chemical Synthesis;Fluorinated Building Blocks;Halogenated Hydrocarbons;Organic Building Blocks;Organic Fluorinated Building Blocks;Other Fluorinated Organic Building Blocks;C6 | | Mol File: | 344-07-0.mol |  |
| | Chloropentafluorobenzene Chemical Properties |
| Melting point | -15.66°C | | Boiling point | 122-123 °C/750 mmHg (lit.) | | density | 1.568 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.424(lit.) | | Fp | 116-118°C | | storage temp. | Refrigerator | | form | Liquid | | color | Clear colorless | | Specific Gravity | 1.651.568 | | BRN | 1819389 | | InChI | InChI=1S/C6ClF5/c7-1-2(8)4(10)6(12)5(11)3(1)9 | | InChIKey | KGCDGLXSBHJAHZ-UHFFFAOYSA-N | | SMILES | C1(Cl)=C(F)C(F)=C(F)C(F)=C1F | | CAS DataBase Reference | 344-07-0(CAS DataBase Reference) | | EPA Substance Registry System | Benzene, chloropentafluoro- (344-07-0) |
| Hazard Codes | Xn,Xi | | Risk Statements | 20-36/37/38 | | Safety Statements | 23-24/25-26 | | WGK Germany | 2 | | RTECS | CZ1225500 | | Hazard Note | Irritant | | TSCA | TSCA listed | | HS Code | 29039990 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Inhalation | | Toxicity | dns-rat:lvr 10 mg/L NTIS** AD-A165-849 |
| | Chloropentafluorobenzene Usage And Synthesis |
| Chemical Properties | CLEAR COLOURLESS LIQUID | | Uses | Chloropentafluorobenzene has been used in the preparation of:
- 1,2-difluoro-1,2-bis-(pentafluorophenyl)dichlorane via fluorination with elemental fluorine at 128°C
- 5-chloro-1-(difluorochloro)-2,3,4,5,6,6-hexafluoro-1,3-cyclohexadiene via reaction with chlorine trifluoride at 78°C
| | General Description | Reaction between chloropentafluorobenzene and strong N-bases in polar aprotic solvents and in the presence of water has been investigated. Chloropentafluorobenzene on reaction with ammonia yields 4-chloro-2,3,5,6-tetrafluoroaniline and 2-chloro-3,4,5,6-tetrafluoroaniline. | | Safety Profile | Experimental teratogenic effects reported. Mutation data reported. When heated to decomposition it emits toxic vapors of Fí and Clí. |
| | Chloropentafluorobenzene Preparation Products And Raw materials |
|