| Company Name: |
Capot Chemical Co.,Ltd. |
| Tel: |
+86-(0)57185586718; +8613336195806 |
| Email: |
sales@capot.com |
| Products Intro: |
Product Name:2,2,3,3,4,4,4-Heptafluoro-1-butanol CAS:375-01-9 Purity:98%(Min,GC) Package:100g;1kg;5kg,10kg,25kg,50kg
|
|
|
|
|
|
| | 2,2,3,3,4,4,4-Heptafluoro-1-butanol Basic information |
| Product Name: | 2,2,3,3,4,4,4-Heptafluoro-1-butanol | | Synonyms: | alpha,alpha-Dihydroperfluorobutanol;Butanol, 2,2,3,3,4,4,4-heptafluoro-;butanol,2,2,3,3,4,4,4-heptafluoro-;HEPTAFLUOROBUTANOL;HEPTAFLUORO-1-BUTANOL;1H,1H-DIHYDROHEPTAFLUORO-1-BUTANOL;1H,1H-HEPTAFLUORO-1-BUTANOL;1H,1H-HEPTAFLUOROBUTAN-1-OL | | CAS: | 375-01-9 | | MF: | C4H3F7O | | MW: | 200.05 | | EINECS: | 206-782-1 | | Product Categories: | Building Blocks;C2 to C6;Chemical Synthesis;Fluorinated Building Blocks;Organic Building Blocks;Organic Fluorinated Building Blocks;Other Fluorinated Organic Building Blocks;Oxygen Compounds;Alcohols;Alkyl Fluorinated Building Blocks | | Mol File: | 375-01-9.mol |  |
| | 2,2,3,3,4,4,4-Heptafluoro-1-butanol Chemical Properties |
| Boiling point | 96-97 °C(lit.) | | density | 1.6 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.3(lit.) | | Fp | 77 °F | | storage temp. | Flammables area | | pka | 12.53±0.10(Predicted) | | form | Crystalline Powder | | color | White to light beige | | Specific Gravity | 1.600 | | Water Solubility | Not miscible or difficult to mix in water. | | BRN | 1761907 | | InChI | InChI=1S/C4H3F7O/c5-2(6,1-12)3(7,8)4(9,10)11/h12H,1H2 | | InChIKey | WXJFKAZDSQLPBX-UHFFFAOYSA-N | | SMILES | C(O)C(F)(F)C(F)(F)C(F)(F)F | | CAS DataBase Reference | 375-01-9(CAS DataBase Reference) | | EPA Substance Registry System | 1-Butanol, 2,2,3,3,4,4,4-heptafluoro- (375-01-9) |
| Hazard Codes | Xi,F | | Risk Statements | 10-36/37/38 | | Safety Statements | 16-26 | | RIDADR | UN 1987 3/PG 3 | | WGK Germany | 2 | | RTECS | EL4130000 | | Hazard Note | Flammable/Irritant | | TSCA | TSCA listed | | HazardClass | 3 | | PackingGroup | III | | HS Code | 29055900 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Flam. Liq. 3 |
| | 2,2,3,3,4,4,4-Heptafluoro-1-butanol Usage And Synthesis |
| Chemical Properties | CLEAR COLOURLESS LIQUID | | Uses | 2,2,3,3,4,4,4-Heptafluoro-1-butanol can be used to synthesize poly(2-hydroxyethyl vinyl ether)-block-poly(2-(2,2,3,3,4,4,4-heptafluorobutoxy)ethyl vinyl ether) (poly(HOVE-b-HFBOVE), a fluorinated amphiphilic block copolymer. |
| | 2,2,3,3,4,4,4-Heptafluoro-1-butanol Preparation Products And Raw materials |
| Raw materials | isopropyl heptafluorobutanoate-->Magnesium, (heptafluoropropyl)iodo- (9CI)-->Butanoic acid, 2,2,3,3,4,4,4-heptafluoro-, 2,2,3,3,4,4,4-heptafluorobutyl ester-->3-Hexanol, 4,4,5,5,6,6,6-heptafluoro--->Heptafluorobutyraldehydehydrate,tech-->HEPTAFLUOROBUTYRALDEHYDE HYDRATE, TECH.-->METHYL HEPTAFLUOROBUTYRATE-->Heptafluorobutyryl chloride-->ETHYL HEPTAFLUOROBUTYRATE-->DIMETHYLPHENYLSILANOL-->ethylmagnesium iodide-->Diethyl ether-->Chloral hydrate-->Heptafluorobutyric acid | | Preparation Products | Heptafluorobutanal methyl hemiacetal |
|