|
|
| | 2,7-Dinitrofluorene Basic information |
| Product Name: | 2,7-Dinitrofluorene | | Synonyms: | 2,7-Dinitrofluorene,98%;2,7-DINITROFLUORENE 95+%;2,7-DINITROFLUORENE;2,7-Dinitroflu;2,7-Dinitrofluorene,97%;2,7-Dinitro-9H-fluorene;2,7-dinitro-fluoren;9H-Fluorene, 2,7-dinitro- | | CAS: | 5405-53-8 | | MF: | C13H8N2O4 | | MW: | 256.21 | | EINECS: | 226-457-8 | | Product Categories: | Fluorenes, Flurenones;Fluorene Derivatives;Fluorenes;Fluorenes & Fluorenones;Nitro Compounds;Nitrogen Compounds;Organic Building Blocks | | Mol File: | 5405-53-8.mol |  |
| | 2,7-Dinitrofluorene Chemical Properties |
| Melting point | 330-334°C | | Boiling point | 399.45°C (rough estimate) | | density | 1.3298 (rough estimate) | | refractive index | 1.5300 (estimate) | | storage temp. | Refrigerator | | solubility | DMSO (Slightly) | | form | Solid | | color | Light Yellow | | BRN | 2057852 | | InChI | 1S/C13H8N2O4/c16-14(17)10-1-3-12-8(6-10)5-9-7-11(15(18)19)2-4-13(9)12/h1-4,6-7H,5H2 | | InChIKey | IHZCVUBSTYOFSJ-UHFFFAOYSA-N | | SMILES | [O-][N+](=O)c1ccc-2c(Cc3cc(ccc-23)[N+]([O-])=O)c1 | | CAS DataBase Reference | 5405-53-8(CAS DataBase Reference) | | NIST Chemistry Reference | 9H-fluorene, 2,7-dinitro-(5405-53-8) | | EPA Substance Registry System | 9H-Fluorene, 2,7-dinitro- (5405-53-8) |
| Hazard Codes | Xn | | Risk Statements | 40 | | Safety Statements | 7-22-36/37/39-45-36 | | WGK Germany | 3 | | RTECS | LL7175000 | | HS Code | 29042090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Carc. 2 |
| | 2,7-Dinitrofluorene Usage And Synthesis |
| Chemical Properties | yellow powder | | Uses | 2,7-Dinitrofluorene was used as a reagent in the synthesis of benzidine and diaminofluorene prolinamide derivatives which are potent hepatitis C virus NS5A inhibitors. Also used in the synthesis of symmetric anionic polymethine dyes derived from fluorene. |
| | 2,7-Dinitrofluorene Preparation Products And Raw materials |
|