- Boc-L-Trp-ol
-
- $0.00/ kg
-
2025-10-31
- CAS:82689-19-8
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
|
| | N-alpha-Boc-L-tryptophanol Basic information |
| | N-alpha-Boc-L-tryptophanol Chemical Properties |
| Melting point | 118-122 °C(lit.) | | alpha | -51°(20℃, c=2, CH3COOH) | | Boiling point | 518.1±45.0 °C(Predicted) | | density | 1.190±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | soluble in Methanol | | form | Powder | | pka | 12.06±0.46(Predicted) | | color | White to off-white | | Optical Rotation | [α]20/D 30°, c = 2 in acetic acid | | InChI | InChI=1S/C16H22N2O3/c1-16(2,3)21-15(20)18-12(10-19)8-11-9-17-14-7-5-4-6-13(11)14/h4-7,9,12,17,19H,8,10H2,1-3H3,(H,18,20)/t12-/m0/s1 | | InChIKey | JEFQUFUAEKORKL-LBPRGKRZSA-N | | SMILES | C(OC(C)(C)C)(=O)N[C@@H](CC1C2=C(NC=1)C=CC=C2)CO | | CAS DataBase Reference | 82689-19-8(CAS DataBase Reference) |
| WGK Germany | 3 | | HS Code | 29339900 |
| | N-alpha-Boc-L-tryptophanol Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | peptide synthesis | | reaction suitability | reaction type: solution phase peptide synthesis |
| | N-alpha-Boc-L-tryptophanol Preparation Products And Raw materials |
|