|
|
| | 2,3-Dimethylindole Basic information |
| Product Name: | 2,3-Dimethylindole | | Synonyms: | 2,3-DIMETHYLINDOLINE;2,3-DIMETHYLINDOLE;2,3-dimethyl-1h-indol;5-ethyl-5-methyl-2-(phenylmethyl)-1,3-dioxane;2,3-dimethyl-indol;Indole, 2,3-dimethyl-;2,3-DIMETHYLINDOLE, 97+%;1H-Indole, 2,3-dimethyl- | | CAS: | 91-55-4 | | MF: | C10H11N | | MW: | 145.2 | | EINECS: | 202-076-2 | | Product Categories: | Building Blocks;Heterocyclic Building Blocks;Intermediates of Dyes and Pigments;Indoles and derivatives;Indole;Indoles;Simple Indoles;Heterocycle-Indole series | | Mol File: | 91-55-4.mol |  |
| | 2,3-Dimethylindole Chemical Properties |
| Melting point | 105-107 °C (lit.) | | Boiling point | 285 °C (lit.) | | density | 1.0641 (estimate) | | refractive index | 1.6030 (estimate) | | Fp | 285°C/750mm | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 17.87±0.30(Predicted) | | form | Solid | | color | White to Amber | | BRN | 116662 | | InChI | InChI=1S/C10H11N/c1-7-8(2)11-10-6-4-3-5-9(7)10/h3-6,11H,1-2H3 | | InChIKey | PYFVEIDRTLBMHG-UHFFFAOYSA-N | | SMILES | N1C2=C(C=CC=C2)C(C)=C1C | | CAS DataBase Reference | 91-55-4(CAS DataBase Reference) | | NIST Chemistry Reference | 1H-Indole, 2,3-dimethyl-(91-55-4) | | EPA Substance Registry System | 1H-Indole, 2,3-dimethyl- (91-55-4) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | RTECS | NL7185000 | | TSCA | TSCA listed | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids |
| | 2,3-Dimethylindole Usage And Synthesis |
| Chemical Properties | White to yellow powder | | Uses | 2,3-Dimethylindole has been used to study the mechanism of oxidation of 2,3-dimethylindole by peroxodisulphate and peroxomonosulphate anions to 2-methylindole-2-carbaldehyde. It has been used to study the behaviour of methylindoles in the agilent multimode ion source by atmospheric pressure chemical ionization mass spectrometry. |
| | 2,3-Dimethylindole Preparation Products And Raw materials |
|