|
|
| | 1,3-Bis((3-methyl-2,5-dioxopyrrol-1-yl)methyl)benzol Basic information |
| | 1,3-Bis((3-methyl-2,5-dioxopyrrol-1-yl)methyl)benzol Chemical Properties |
| Boiling point | 533.1±43.0 °C(Predicted) | | density | 1.378±0.06 g/cm3(Predicted) | | vapor pressure | 0Pa at 25℃ | | solubility | 10 in mg/100g standard fat at 20 ℃ | | pka | -2.02±0.40(Predicted) | | Water Solubility | 40.8mg/L at 20℃ | | InChI | InChI=1S/C18H16N2O4/c1-11-6-15(21)19(17(11)23)9-13-4-3-5-14(8-13)10-20-16(22)7-12(2)18(20)24/h3-8H,9-10H2,1-2H3 | | InChIKey | MIIBUHIQXLFJFP-UHFFFAOYSA-N | | SMILES | C1(CN2C(=O)C=C(C)C2=O)=CC=CC(CN2C(=O)C=C(C)C2=O)=C1 | | LogP | 2.22 at 20℃ | | EPA Substance Registry System | 1H-Pyrrole-2,5-dione, 1,1'-[1,3-phenylenebis(methylene)]bis[3-methyl- (119462-56-5) |
| | 1,3-Bis((3-methyl-2,5-dioxopyrrol-1-yl)methyl)benzol Usage And Synthesis |
| Chemical Properties | White powder | | Flammability and Explosibility | Not classified |
| | 1,3-Bis((3-methyl-2,5-dioxopyrrol-1-yl)methyl)benzol Preparation Products And Raw materials |
|