|
|
| | 7-Amino-heptanoic acid ethyl ester hydrochloride Basic information |
| Product Name: | 7-Amino-heptanoic acid ethyl ester hydrochloride | | Synonyms: | 7-Amino-heptanoic acid ethyl ester hydrochloride;Ethyl7-AminoheptanoateHCl;Ethyl7-Aminoheptanoatehydrochloride;7-AMINO-HEPTANOIC ACID ETHYL ESTER HCL;7-AMINOHEPTANOIC ACID ETHYL ESTER HYDROCLORIDE;7-AMINO-HEPTANOIC ACID ETHYL ESTER HCL 97%;7-AMINOHEPTANOICETHYLESTERHCL;Tianeptine InterMediate | | CAS: | 29840-65-1 | | MF: | C9H20ClNO2 | | MW: | 209.71 | | EINECS: | 608-419-6 | | Product Categories: | Tianeptine Intermediates | | Mol File: | 29840-65-1.mol |  |
| | 7-Amino-heptanoic acid ethyl ester hydrochloride Chemical Properties |
| Melting point | 119-122oC | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Methanol (Slightly), Water (Slightly) | | form | Solid | | color | Off-White to Pale Red | | InChI | InChI=1S/C9H19NO2.ClH/c1-2-12-9(11)7-5-3-4-6-8-10;/h2-8,10H2,1H3;1H | | InChIKey | UJSRNPWHNTUQEH-UHFFFAOYSA-N | | SMILES | C(=O)(OCC)CCCCCCN.Cl |
| | 7-Amino-heptanoic acid ethyl ester hydrochloride Usage And Synthesis |
| Uses | 7-Aminoheptanoic Acid Ethyl Ester is a ω-amino acid ester used in the preparation of potential anticancer agents. |
| | 7-Amino-heptanoic acid ethyl ester hydrochloride Preparation Products And Raw materials |
|