|
|
| | 1,1-Dimethyl-thiourea Basic information |
| Product Name: | 1,1-Dimethyl-thiourea | | Synonyms: | 1,1-dimethyl-2-thiourea;1,1-Dimethyl-thiourea;Ai3-17358;Einecs 230-204-7;Nsc 67246;Thiourea, N,N-dimethyl- (9ci);Urea, 1,1-dimethyl-2-thio- (8ci);Urea, 1,1-dimethyl-2-thio- | | CAS: | 6972-05-0 | | MF: | C3H8N2S | | MW: | 104.17 | | EINECS: | 230-204-7 | | Product Categories: | | | Mol File: | 6972-05-0.mol |  |
| | 1,1-Dimethyl-thiourea Chemical Properties |
| Melting point | 163-164 °C | | Boiling point | 144.6±23.0 °C(Predicted) | | density | 1.108±0.06 g/cm3(Predicted) | | pka | 15.52±0.29(Predicted) | | InChI | InChI=1S/C3H8N2S/c1-5(2)3(4)6/h1-2H3,(H2,4,6) | | InChIKey | ZQGWBPQBZHMUFG-UHFFFAOYSA-N | | SMILES | N(C)(C)C(N)=S |
| | 1,1-Dimethyl-thiourea Usage And Synthesis |
| Uses | N,N-dimethylthiourea is used in preparation of sodium gluconate drug intermediate. |
| | 1,1-Dimethyl-thiourea Preparation Products And Raw materials |
|