Clomiphene Citrate manufacturers
|
| | Clomiphene Citrate Basic information |
| | Clomiphene Citrate Chemical Properties |
| InChIKey | PYTMYKVIJXPNBD-BTKVJIOYSA-N | | SMILES | C(=C(/Cl)\C1=CC=CC=C1)(/C1=CC=CC=C1)\C1C=CC(OCCN(CC)CC)=CC=1.C(O)(C(=O)O)(CC(=O)O)CC(=O)O |
| | Clomiphene Citrate Usage And Synthesis |
| Description | Clomifene Citrate, the trade name of French dilan. Induction of ovulation in women with the following conditions: hypothalamic-pituitary dysfunction, including polycystic ovary syndrome (PCOS); induction of multiple follicles in women undergoing superovulation by assisted conception techniques such as in vitro fertilization (IVF). | | Uses | Clomiphene Citrate is a hormonal drugs for the treatment of luteal insufficiency, anovulatory infertility, and functional uterine bleeding. |
| | Clomiphene Citrate Preparation Products And Raw materials |
|