|
|
| | 2-(dimethylamino)ethyl diphenyl(prop-2-ynyloxy)acetate hydrochloride Basic information |
| | 2-(dimethylamino)ethyl diphenyl(prop-2-ynyloxy)acetate hydrochloride Chemical Properties |
| Melting point | 162-163 °C | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Light Yellow | | Stability: | Hygroscopic | | InChI | InChI=1S/C21H23NO3.ClH/c1-4-16-25-21(18-11-7-5-8-12-18,19-13-9-6-10-14-19)20(23)24-17-15-22(2)3;/h1,5-14H,15-17H2,2-3H3;1H | | InChIKey | RSBGQTFIHFGTSY-UHFFFAOYSA-N | | SMILES | C(OCCN(C)C)(=O)C(C1=CC=CC=C1)(C1=CC=CC=C1)OCC#C.[H]Cl |
| | 2-(dimethylamino)ethyl diphenyl(prop-2-ynyloxy)acetate hydrochloride Usage And Synthesis |
| Uses | Propinox is an antispasmodic agent. Studies show that Propinox is effective in the treatment of moderate to severe colic pain of biliary origin. |
| | 2-(dimethylamino)ethyl diphenyl(prop-2-ynyloxy)acetate hydrochloride Preparation Products And Raw materials |
|