|
|
| | ETHYL 2-HYDROXYPHENYLACETATE Basic information |
| Product Name: | ETHYL 2-HYDROXYPHENYLACETATE | | Synonyms: | (2-Hydroxyphenyl)acetic acid ethyl ester;2-Hydroxybenzeneacetic acid ethyl ester;2-(2-Hydroxyphenyl)acetic Acid Ethyl Ester;Benzeneacetic acid,2-hydroxy-, ethyl ester;ETHYL 2-HYDROXYPHENYLACETATE;Ethyl 2-(2-hydroxyphenyl)acetate | | CAS: | 41873-65-8 | | MF: | C10H12O3 | | MW: | 180.2 | | EINECS: | 255-572-6 | | Product Categories: | Aromatics;Intermediates | | Mol File: | 41873-65-8.mol |  |
| | ETHYL 2-HYDROXYPHENYLACETATE Chemical Properties |
| Melting point | 67-68 °C | | Boiling point | 105°C@0.35-0.45mmHg. | | density | 1.146±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | form | Off-White to Pale Yellow Semisolid | | pka | 9.86±0.30(Predicted) | | Appearance | Light yellow to yellow Liquid | | Stability: | Store in Freezer | | InChI | InChI=1S/C10H12O3/c1-2-13-10(12)7-8-5-3-4-6-9(8)11/h3-6,11H,2,7H2,1H3 | | InChIKey | XTRBBJJVAIWTPL-UHFFFAOYSA-N | | SMILES | C1(CC(OCC)=O)=CC=CC=C1O |
| | ETHYL 2-HYDROXYPHENYLACETATE Usage And Synthesis |
| Chemical Properties | Light Yellow Liquid | | Uses | Ethyl 2-Hydroxyphenylacetate is a useful synthetic intermediate for the preparation of novel antiinflammatory agents. |
| | ETHYL 2-HYDROXYPHENYLACETATE Preparation Products And Raw materials |
|