|
|
| | 6-(chloromethyl)pteridine-2,4-diamine monohydrochloride Basic information |
| Product Name: | 6-(chloromethyl)pteridine-2,4-diamine monohydrochloride | | Synonyms: | 6-(chloromethyl)pteridine-2,4-diamine monohydrochloride;Folic Acid IMpurity: 6-(chloroMethyl)pteridine-2,4-DiaMine HCl;6-(Chloromethyl)-2,4-pteridinediamine monohydrochloride;6-(chloromethyl)pteridine-2,4-diamine,hydrochloride;Desoximetasone Impurity;6-Hydroxy Dexamethasone (Mixture of Diastereomers);6-(Chloromethyl)pteridine-2,4-diamine;Folic Acid Impurity 42 | | CAS: | 82778-08-3 | | MF: | C7H8Cl2N6 | | MW: | 247.08 | | EINECS: | 280-027-4 | | Product Categories: | | | Mol File: | 82778-08-3.mol |  |
| | 6-(chloromethyl)pteridine-2,4-diamine monohydrochloride Chemical Properties |
| InChI | InChI=1S/C7H7ClN6.ClH/c8-1-3-2-11-6-4(12-3)5(9)13-7(10)14-6;/h2H,1H2,(H4,9,10,11,13,14);1H | | InChIKey | SDZKFWPFFHILFI-UHFFFAOYSA-N | | SMILES | NC1=NC(N)=NC2=NC=C(CCl)N=C12.Cl |
| | 6-(chloromethyl)pteridine-2,4-diamine monohydrochloride Usage And Synthesis |
| Uses | 6-(chloromethyl)pteridine-2,4-diamine monohydrochloride is a folic acid impurity. It is suitable for drug research and development, production and declaration.
| | Biological Activity | Research indicates that 6-(chloromethyl)pteridine-2,4-diamine monohydrochloride exhibits cytotoxicity
against various cancer cell lines. This compound has been studied for
its potential to inhibit tumor growth and induce apoptosis in cancer
cells. The mechanism of action is thought to involve interference with
cellular signaling pathways critical for cell proliferation and
survival. |
| | 6-(chloromethyl)pteridine-2,4-diamine monohydrochloride Preparation Products And Raw materials |
|