|
|
| | bis(4-chloro-3-nitrophenyl) sulphone Basic information |
| Product Name: | bis(4-chloro-3-nitrophenyl) sulphone | | Synonyms: | bis(4-chloro-3-nitrophenyl) sulphone;1-chloro-4-(4-chloro-3-nitrophenylsulfonyl)-2-nitroenzene;4,4'-Dichloro-3,3'-dinitrodiphenyl sulfone;1,1'-sulfonylbis[4-chloro-3-nitro-Benzene;bis(4-chloro-3-nitrophenyl)sulfone;4,4'-Sulfonylbis(1-chloro-2-nitrobenzene);Benzene,1,1'-sulfonylbis[4-chloro-3-nitro- | | CAS: | 1759-05-3 | | MF: | C12H6Cl2N2O6S | | MW: | 377.16 | | EINECS: | 217-159-9 | | Product Categories: | | | Mol File: | 1759-05-3.mol |  |
| | bis(4-chloro-3-nitrophenyl) sulphone Chemical Properties |
| Melting point | 202 °C | | Boiling point | 561.0±50.0 °C(Predicted) | | density | 1.673±0.06 g/cm3(Predicted) |
| RIDADR | 1759 | | HazardClass | 8 | | PackingGroup | III |
| | bis(4-chloro-3-nitrophenyl) sulphone Usage And Synthesis |
| | bis(4-chloro-3-nitrophenyl) sulphone Preparation Products And Raw materials |
|